1-[6-(2,6-dioxo-1-piperidyl)hexyl]piperidine-2,6-dione structure
|
Common Name | 1-[6-(2,6-dioxo-1-piperidyl)hexyl]piperidine-2,6-dione | ||
|---|---|---|---|---|
| CAS Number | 19242-80-9 | Molecular Weight | 308.37300 | |
| Density | 1.183g/cm3 | Boiling Point | 547.8ºC at 760 mmHg | |
| Molecular Formula | C16H24N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 258.9ºC | |
| Name | 1-[6-(2,6-dioxopiperidin-1-yl)hexyl]piperidine-2,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.183g/cm3 |
|---|---|
| Boiling Point | 547.8ºC at 760 mmHg |
| Molecular Formula | C16H24N2O4 |
| Molecular Weight | 308.37300 |
| Flash Point | 258.9ºC |
| Exact Mass | 308.17400 |
| PSA | 74.76000 |
| LogP | 1.50080 |
| Vapour Pressure | 4.71E-12mmHg at 25°C |
| Index of Refraction | 1.523 |
| InChIKey | HUQSSAUBQZKBFY-UHFFFAOYSA-N |
| SMILES | O=C1CCCC(=O)N1CCCCCCN1C(=O)CCCC1=O |
|
~78%
1-[6-(2,6-dioxo... CAS#:19242-80-9 |
| Literature: Haces, Alberto; Breitman, Theodore B. R.; Driscoll, John S. Journal of Medicinal Chemistry, 1987 , vol. 30, # 2 p. 405 - 409 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1,1'-hexane-1,6-diyldipiperidine-2,6-dione |
| 1,1'-(1,6-hexanediyl)bis(2,6-piperidinedione) |