(2S)-5,7,4'-Trihydroxy-6-(1,1-dimethylallyl)flavanone
Modify Date: 2025-08-20 19:48:13
(2S)-5,7,4'-Trihydroxy-6-(1,1-dimethylallyl)flavanone structure
|
Common Name | (2S)-5,7,4'-Trihydroxy-6-(1,1-dimethylallyl)flavanone | ||
|---|---|---|---|---|
| CAS Number | 192572-93-3 | Molecular Weight | 340.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H20O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2S)-5,7,4'-Trihydroxy-6-(1,1-dimethylallyl)flavanone |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C20H20O5 |
|---|---|
| Molecular Weight | 340.4 |
| InChIKey | GKOWEQNADRJYIA-HNNXBMFYSA-N |
| SMILES | C=CC(C)(C)c1c(O)cc2c(c1O)C(=O)CC(c1ccc(O)cc1)O2 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Antiviral activity against HIV assessed as protection against virus-induced cytopathi...
Source: ChEMBL
Target: Human immunodeficiency virus
External Id: CHEMBL948692
|
Total 1, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of (2S)-5,7,4'-Trihydroxy-6-(1,1-dimethylallyl)flavanone? |
| A: The English name of (2S)-5,7,4'-Trihydroxy-6-(1,1-dimethylallyl)flavanone is (2S)-5,7,4'-Trihydroxy-6-(1,1-dimethylallyl)flavanone. |
| Q: What is the SMILES notation of (2S)-5,7,4'-Trihydroxy-6-(1,1-dimethylallyl)flavanone? |
| A: SMILES notation of (2S)-5,7,4'-Trihydroxy-6-(1,1-dimethylallyl)flavanone is C=CC(C)(C)c1c(O)cc2c(c1O)C(=O)CC(c1ccc(O)cc1)O2. |
| Q: What is the InChIKey of (2S)-5,7,4'-Trihydroxy-6-(1,1-dimethylallyl)flavanone? |
| A: InChIKey of (2S)-5,7,4'-Trihydroxy-6-(1,1-dimethylallyl)flavanone is GKOWEQNADRJYIA-HNNXBMFYSA-N. |
| Q: What is the Chinese name of 192572-93-3? |
| A: Chinese name of 192572-93-3 is 192572-93-3. |
| Q: What is the CAS number of (2S)-5,7,4'-Trihydroxy-6-(1,1-dimethylallyl)flavanone? |
| A: CAS number of (2S)-5,7,4'-Trihydroxy-6-(1,1-dimethylallyl)flavanone is 192572-93-3. |
| Q: What is the molecular formula of (2S)-5,7,4'-Trihydroxy-6-(1,1-dimethylallyl)flavanone? |
| A: Molecular formula of (2S)-5,7,4'-Trihydroxy-6-(1,1-dimethylallyl)flavanone is C20H20O5. |
| Q: What is the molecular weight of (2S)-5,7,4'-Trihydroxy-6-(1,1-dimethylallyl)flavanone? |
| A: Molecular weight of (2S)-5,7,4'-Trihydroxy-6-(1,1-dimethylallyl)flavanone is 340.4. |