(2S)-1,1-difluoro-1-[4-(2-methoxyethyl)phenoxy]-3-nitropropan-2-ol structure
|
Common Name | (2S)-1,1-difluoro-1-[4-(2-methoxyethyl)phenoxy]-3-nitropropan-2-ol | ||
|---|---|---|---|---|
| CAS Number | 192575-81-8 | Molecular Weight | 291.24800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H15F2NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2S)-1,1-difluoro-1-[4-(2-methoxyethyl)phenoxy]-3-nitropropan-2-ol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H15F2NO5 |
|---|---|
| Molecular Weight | 291.24800 |
| Exact Mass | 291.09200 |
| PSA | 84.51000 |
| LogP | 2.00790 |
| InChIKey | GSZOLQAZKLWRQY-NSHDSACASA-N |
| SMILES | COCCc1ccc(OC(F)(F)C(O)C[N+](=O)[O-])cc1 |
|
~63%
(2S)-1,1-difluo... CAS#:192575-81-8 |
| Literature: Iseki, Katsuhiko; Oishi, Satoshi; Sasai, Hiroaki; Shibasaki, Masakatsu Bioorganic and Medicinal Chemistry Letters, 1997 , vol. 7, # 10 p. 1273 - 1274 |
|
~%
(2S)-1,1-difluo... CAS#:192575-81-8 |
| Literature: Iseki, Katsuhiko; Oishi, Satoshi; Sasai, Hiroaki; Shibasaki, Masakatsu Bioorganic and Medicinal Chemistry Letters, 1997 , vol. 7, # 10 p. 1273 - 1274 |
|
~%
(2S)-1,1-difluo... CAS#:192575-81-8 |
| Literature: Iseki, Katsuhiko; Oishi, Satoshi; Sasai, Hiroaki; Shibasaki, Masakatsu Bioorganic and Medicinal Chemistry Letters, 1997 , vol. 7, # 10 p. 1273 - 1274 |
| 2-Propanol,1,1-difluoro-1-[4-(2-methoxyethyl)phenoxy]-3-nitro-,(S) |
| (S)-1,1-difluoro-1-[4-(2-methoxyethyl)phenyl]oxy-3-nitropropan-2-ol |