(2S)-1,1-difluoro-1-[4-(2-methoxyethyl)phenoxy]-3-nitropropan-2-ol
![(2S)-1,1-difluoro-1-[4-(2-methoxyethyl)phenoxy]-3-nitropropan-2-ol Structure](https://image.chemsrc.com/caspic/224/192575-81-8.png)
(2S)-1,1-difluoro-1-[4-(2-methoxyethyl)phenoxy]-3-nitropropan-2-ol structure
|
Common Name | (2S)-1,1-difluoro-1-[4-(2-methoxyethyl)phenoxy]-3-nitropropan-2-ol | ||
|---|---|---|---|---|
| CAS Number | 192575-81-8 | Molecular Weight | 291.24800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H15F2NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2S)-1,1-difluoro-1-[4-(2-methoxyethyl)phenoxy]-3-nitropropan-2-ol |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H15F2NO5 |
|---|---|
| Molecular Weight | 291.24800 |
| Exact Mass | 291.09200 |
| PSA | 84.51000 |
| LogP | 2.00790 |
| InChIKey | GSZOLQAZKLWRQY-NSHDSACASA-N |
| SMILES | COCCc1ccc(OC(F)(F)C(O)C[N+](=O)[O-])cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~63%
(2S)-1,1-difluo... CAS#:192575-81-8 |
| Literature: Iseki, Katsuhiko; Oishi, Satoshi; Sasai, Hiroaki; Shibasaki, Masakatsu Bioorganic and Medicinal Chemistry Letters, 1997 , vol. 7, # 10 p. 1273 - 1274 |
|
~%
(2S)-1,1-difluo... CAS#:192575-81-8 |
| Literature: Iseki, Katsuhiko; Oishi, Satoshi; Sasai, Hiroaki; Shibasaki, Masakatsu Bioorganic and Medicinal Chemistry Letters, 1997 , vol. 7, # 10 p. 1273 - 1274 |
|
~%
(2S)-1,1-difluo... CAS#:192575-81-8 |
| Literature: Iseki, Katsuhiko; Oishi, Satoshi; Sasai, Hiroaki; Shibasaki, Masakatsu Bioorganic and Medicinal Chemistry Letters, 1997 , vol. 7, # 10 p. 1273 - 1274 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-Propanol,1,1-difluoro-1-[4-(2-methoxyethyl)phenoxy]-3-nitro-,(S) |
| (S)-1,1-difluoro-1-[4-(2-methoxyethyl)phenyl]oxy-3-nitropropan-2-ol |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of (2S)-1,1-difluoro-1-[4-(2-methoxyethyl)phenoxy]-3-nitropropan-2-ol? |
| A: InChIKey of (2S)-1,1-difluoro-1-[4-(2-methoxyethyl)phenoxy]-3-nitropropan-2-ol is GSZOLQAZKLWRQY-NSHDSACASA-N. |
| Q: What is the molecular formula of (2S)-1,1-difluoro-1-[4-(2-methoxyethyl)phenoxy]-3-nitropropan-2-ol? |
| A: Molecular formula of (2S)-1,1-difluoro-1-[4-(2-methoxyethyl)phenoxy]-3-nitropropan-2-ol is C12H15F2NO5. |
| Q: What is the Chinese name of 192575-81-8? |
| A: Chinese name of 192575-81-8 is 192575-81-8. |
| Q: What is the LogP of (2S)-1,1-difluoro-1-[4-(2-methoxyethyl)phenoxy]-3-nitropropan-2-ol? |
| A: LogP of (2S)-1,1-difluoro-1-[4-(2-methoxyethyl)phenoxy]-3-nitropropan-2-ol is 2.00790. |
| Q: What is the English name of (2S)-1,1-difluoro-1-[4-(2-methoxyethyl)phenoxy]-3-nitropropan-2-ol? |
| A: The English name of (2S)-1,1-difluoro-1-[4-(2-methoxyethyl)phenoxy]-3-nitropropan-2-ol is (2S)-1,1-difluoro-1-[4-(2-methoxyethyl)phenoxy]-3-nitropropan-2-ol. |
| Q: What is the molecular weight of (2S)-1,1-difluoro-1-[4-(2-methoxyethyl)phenoxy]-3-nitropropan-2-ol? |
| A: Molecular weight of (2S)-1,1-difluoro-1-[4-(2-methoxyethyl)phenoxy]-3-nitropropan-2-ol is 291.24800. |
| Q: What English synonyms does (2S)-1,1-difluoro-1-[4-(2-methoxyethyl)phenoxy]-3-nitropropan-2-ol have? |
| A: English synonyms of (2S)-1,1-difluoro-1-[4-(2-methoxyethyl)phenoxy]-3-nitropropan-2-ol: 2-Propanol,1,1-difluoro-1-[4-(2-methoxyethyl)phenoxy]-3-nitro-,(S), (S)-1,1-difluoro-1-[4-(2-methoxyethyl)phenyl]oxy-3-nitropropan-2-ol. |
| Q: What is the polar surface area (PSA) of (2S)-1,1-difluoro-1-[4-(2-methoxyethyl)phenoxy]-3-nitropropan-2-ol? |
| A: Polar surface area (PSA) of (2S)-1,1-difluoro-1-[4-(2-methoxyethyl)phenoxy]-3-nitropropan-2-ol is 84.51000. |
| Q: What is the CAS number of (2S)-1,1-difluoro-1-[4-(2-methoxyethyl)phenoxy]-3-nitropropan-2-ol? |
| A: CAS number of (2S)-1,1-difluoro-1-[4-(2-methoxyethyl)phenoxy]-3-nitropropan-2-ol is 192575-81-8. |
| Q: What is the SMILES notation of (2S)-1,1-difluoro-1-[4-(2-methoxyethyl)phenoxy]-3-nitropropan-2-ol? |
| A: SMILES notation of (2S)-1,1-difluoro-1-[4-(2-methoxyethyl)phenoxy]-3-nitropropan-2-ol is COCCc1ccc(OC(F)(F)C(O)C[N+](=O)[O-])cc1. |