2,4-D-propyl structure
|
Common Name | 2,4-D-propyl | ||
|---|---|---|---|---|
| CAS Number | 1928-61-6 | Molecular Weight | 263.11700 | |
| Density | 1.272g/cm3 | Boiling Point | 328.9ºC at 760mmHg | |
| Molecular Formula | C11H12Cl2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 129.6ºC | |
| Name | 2,4-D-propyl |
|---|---|
| Synonym | More Synonyms |
| Density | 1.272g/cm3 |
|---|---|
| Boiling Point | 328.9ºC at 760mmHg |
| Molecular Formula | C11H12Cl2O3 |
| Molecular Weight | 263.11700 |
| Flash Point | 129.6ºC |
| Exact Mass | 262.01600 |
| PSA | 35.53000 |
| LogP | 3.32540 |
| Vapour Pressure | 0.000184mmHg at 25°C |
| Index of Refraction | 1.521 |
| InChIKey | URELEWKDONECLX-UHFFFAOYSA-N |
| SMILES | CCCOC(=O)COc1ccc(Cl)cc1Cl |
| HS Code | 2918990090 |
|---|
|
~72%
2,4-D-propyl CAS#:1928-61-6 |
| Literature: Kumar, Amal K.; Chattopadhyay, Tapas K. Tetrahedron Letters, 1987 , vol. 28, # 32 p. 3713 - 3714 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| propyl 2-(2,4-dichlorophenoxy)acetate |
| propyl 2,4-dichlorophenoxyacetate |
| 2,4-D propyl ester |
| propyl (2,4-dichlorophenoxy)acetate |
| 2,4-Dichlorphenoxyessigsaeure-n-propylester |
| 2,4-Dichlorphenoxyessigsaeure-propylester |