3'-Methoxy-3-(trifluoromethyl)-[1,1'-biphenyl]-4-carboxylic acid
Modify Date: 2026-08-21 10:25:36
![3'-Methoxy-3-(trifluoromethyl)-[1,1'-biphenyl]-4-carboxylic acid Structure](https://www.chemsrc.com/extcaspic/417/1928953-76-7.png)
3'-Methoxy-3-(trifluoromethyl)-[1,1'-biphenyl]-4-carboxylic acid structure
|
Common Name | 3'-Methoxy-3-(trifluoromethyl)-[1,1'-biphenyl]-4-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 1928953-76-7 | Molecular Weight | 296.24 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H11F3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3'-Methoxy-3-(trifluoromethyl)-[1,1'-biphenyl]-4-carboxylic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H11F3O3 |
|---|---|
| Molecular Weight | 296.24 |
| InChIKey | RVAPWORXAYQFDO-UHFFFAOYSA-N |
| SMILES | COc1cccc(-c2ccc(C(=O)O)c(C(F)(F)F)c2)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 3'-Methoxy-3-(trifluoromethyl)-[1,1'-biphenyl]-4-carboxylic acid? |
| A: CAS number of 3'-Methoxy-3-(trifluoromethyl)-[1,1'-biphenyl]-4-carboxylic acid is 1928953-76-7. |
| Q: What is the molecular formula of 3'-Methoxy-3-(trifluoromethyl)-[1,1'-biphenyl]-4-carboxylic acid? |
| A: Molecular formula of 3'-Methoxy-3-(trifluoromethyl)-[1,1'-biphenyl]-4-carboxylic acid is C15H11F3O3. |
| Q: What is the InChIKey of 3'-Methoxy-3-(trifluoromethyl)-[1,1'-biphenyl]-4-carboxylic acid? |
| A: InChIKey of 3'-Methoxy-3-(trifluoromethyl)-[1,1'-biphenyl]-4-carboxylic acid is RVAPWORXAYQFDO-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 3'-Methoxy-3-(trifluoromethyl)-[1,1'-biphenyl]-4-carboxylic acid? |
| A: SMILES notation of 3'-Methoxy-3-(trifluoromethyl)-[1,1'-biphenyl]-4-carboxylic acid is COc1cccc(-c2ccc(C(=O)O)c(C(F)(F)F)c2)c1. |
| Q: What is the molecular weight of 3'-Methoxy-3-(trifluoromethyl)-[1,1'-biphenyl]-4-carboxylic acid? |
| A: Molecular weight of 3'-Methoxy-3-(trifluoromethyl)-[1,1'-biphenyl]-4-carboxylic acid is 296.24. |
| Q: What is the English name of 3'-Methoxy-3-(trifluoromethyl)-[1,1'-biphenyl]-4-carboxylic acid? |
| A: The English name of 3'-Methoxy-3-(trifluoromethyl)-[1,1'-biphenyl]-4-carboxylic acid is 3'-Methoxy-3-(trifluoromethyl)-[1,1'-biphenyl]-4-carboxylic acid. |
| Q: What is the Chinese name of 1928953-76-7? |
| A: Chinese name of 1928953-76-7 is 1928953-76-7. |