1-(4-BROMOPHENYL)-7-CHLORO-1-OXOHEPTANE structure
|
Common Name | 1-(4-BROMOPHENYL)-7-CHLORO-1-OXOHEPTANE | ||
|---|---|---|---|---|
| CAS Number | 193065-67-7 | Molecular Weight | 303.62300 | |
| Density | 1.313g/cm3 | Boiling Point | 393.3ºC at 760 mmHg | |
| Molecular Formula | C13H16BrClO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191.7ºC | |
| Name | 1-(4-bromophenyl)-7-chloroheptan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.313g/cm3 |
|---|---|
| Boiling Point | 393.3ºC at 760 mmHg |
| Molecular Formula | C13H16BrClO |
| Molecular Weight | 303.62300 |
| Flash Point | 191.7ºC |
| Exact Mass | 302.00700 |
| PSA | 17.07000 |
| LogP | 4.82110 |
| Vapour Pressure | 2.15E-06mmHg at 25°C |
| Index of Refraction | 1.535 |
| InChIKey | RGPPQQUQFFSDQO-UHFFFAOYSA-N |
| SMILES | O=C(CCCCCCCl)c1ccc(Br)cc1 |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 1-(4-BROMOPHENYL)-7-CHLORO-1-OXOHEPTANE |
| 1-Heptanone,1-(4-bromophenyl)-7-chloro |