UNII:3I7LZ8M32B structure
|
Common Name | UNII:3I7LZ8M32B | ||
|---|---|---|---|---|
| CAS Number | 19310-00-0 | Molecular Weight | 222.216 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 450.7±45.0 °C at 760 mmHg | |
| Molecular Formula | C11H11FN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 226.4±28.7 °C | |
| Name | (2S)-2-amino-3-(6-fluoro-1H-indol-3-yl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 450.7±45.0 °C at 760 mmHg |
| Molecular Formula | C11H11FN2O2 |
| Molecular Weight | 222.216 |
| Flash Point | 226.4±28.7 °C |
| Exact Mass | 222.080460 |
| PSA | 79.11000 |
| LogP | 1.09 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.673 |
| InChIKey | YMEXGEAJNZRQEH-VIFPVBQESA-N |
| SMILES | NC(Cc1c[nH]c2cc(F)ccc12)C(=O)O |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| DL-6-fluorotryptophan |
| 6-flurotryptophan |
| Tryptophan, 6-fluoro-, DL- |
| Tryptophan, 6-fluoro- |
| L-6-fluorotryptophan |
| 2-Amino-3-(6-fluoro-1H-indol-3-yl)propanoic acid |
| UNII:3I7LZ8M32B |
| 6-Fluoro-L-tryptophan |
| DL-Tryptophan, 6-fluoro- |
| L-Tryptophan,6-fluoro |
| DL-6-Fluorotryptophane |
| 6-Fluorotryptophan |
| L-Tryptophan, 6-fluoro- |