13,14-dihydro PGE1 structure
|
Common Name | 13,14-dihydro PGE1 | ||
|---|---|---|---|---|
| CAS Number | 19313-28-1 | Molecular Weight | 356.497 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 541.4±35.0 °C at 760 mmHg | |
| Molecular Formula | C20H36O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 295.3±22.4 °C | |
Use of 13,14-dihydro PGE113,14-dihydro Prostaglandin E1 (13,14-dihydro PGE1) is a biologically active metabolite of PGE1 with comparable potency to the parent compound. |
| Name | 13,14-dihydroprostaglandin e1 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 541.4±35.0 °C at 760 mmHg |
| Molecular Formula | C20H36O5 |
| Molecular Weight | 356.497 |
| Flash Point | 295.3±22.4 °C |
| Exact Mass | 356.256287 |
| PSA | 94.83000 |
| LogP | 2.23 |
| Vapour Pressure | 0.0±3.3 mmHg at 25°C |
| Index of Refraction | 1.500 |
| InChIKey | DPOINJQWXDTOSF-DODZYUBVSA-N |
| SMILES | CCCCCC(O)CCC1C(O)CC(=O)C1CCCCCCC(=O)O |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 13,14-dihydro PGE1 |
| (11α,15S)-11,15-Dihydroxy-9-oxoprostan-1-oic acid |
| 9-OXO-11ALPHA,15S-DIHYDROXY-PROSTAN-1-OIC ACID |
| prostaglandin E |
| PGE0 |
| 13,14-Dihydroprostaglandinee1 |
| 13,14-dihydro-prostaglandin E1 |
| Prostan-1-oic acid, 11,15-dihydroxy-9-oxo-, (11α,15S)- |
| 7-[(1R,2R,3R)-3-hydroxy-2-[(3S)-3-hydroxyoctyl]-5-oxocyclopentyl]heptanoic acid |