(4S)-2,2-dimethyl-3,4-dihydro-2H-1-benzopyran-4,6-diamine
Modify Date: 2026-07-06 16:00:25
(4S)-2,2-dimethyl-3,4-dihydro-2H-1-benzopyran-4,6-diamine structure
|
Common Name | (4S)-2,2-dimethyl-3,4-dihydro-2H-1-benzopyran-4,6-diamine | ||
|---|---|---|---|---|
| CAS Number | 1931908-97-2 | Molecular Weight | 192.26 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H16N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (4S)-2,2-dimethyl-3,4-dihydro-2H-1-benzopyran-4,6-diamine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H16N2O |
|---|---|
| Molecular Weight | 192.26 |
| InChIKey | FYCCFZCOLQCEAC-VIFPVBQESA-N |
| SMILES | CC1(C)CC(N)c2cc(N)ccc2O1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of (4S)-2,2-dimethyl-3,4-dihydro-2H-1-benzopyran-4,6-diamine? |
| A: The English name of (4S)-2,2-dimethyl-3,4-dihydro-2H-1-benzopyran-4,6-diamine is (4S)-2,2-dimethyl-3,4-dihydro-2H-1-benzopyran-4,6-diamine. |
| Q: What is the CAS number of (4S)-2,2-dimethyl-3,4-dihydro-2H-1-benzopyran-4,6-diamine? |
| A: CAS number of (4S)-2,2-dimethyl-3,4-dihydro-2H-1-benzopyran-4,6-diamine is 1931908-97-2. |
| Q: What is the SMILES notation of (4S)-2,2-dimethyl-3,4-dihydro-2H-1-benzopyran-4,6-diamine? |
| A: SMILES notation of (4S)-2,2-dimethyl-3,4-dihydro-2H-1-benzopyran-4,6-diamine is CC1(C)CC(N)c2cc(N)ccc2O1. |
| Q: What is the InChIKey of (4S)-2,2-dimethyl-3,4-dihydro-2H-1-benzopyran-4,6-diamine? |
| A: InChIKey of (4S)-2,2-dimethyl-3,4-dihydro-2H-1-benzopyran-4,6-diamine is FYCCFZCOLQCEAC-VIFPVBQESA-N. |
| Q: What is the molecular weight of (4S)-2,2-dimethyl-3,4-dihydro-2H-1-benzopyran-4,6-diamine? |
| A: Molecular weight of (4S)-2,2-dimethyl-3,4-dihydro-2H-1-benzopyran-4,6-diamine is 192.26. |
| Q: What is the molecular formula of (4S)-2,2-dimethyl-3,4-dihydro-2H-1-benzopyran-4,6-diamine? |
| A: Molecular formula of (4S)-2,2-dimethyl-3,4-dihydro-2H-1-benzopyran-4,6-diamine is C11H16N2O. |
| Q: What is the Chinese name of 1931908-97-2? |
| A: Chinese name of 1931908-97-2 is 1931908-97-2. |