2-[(3-methoxyphenyl)carbamoyl]benzoic acid structure
|
Common Name | 2-[(3-methoxyphenyl)carbamoyl]benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 19336-97-1 | Molecular Weight | 271.26800 | |
| Density | 1.324g/cm3 | Boiling Point | 391.9ºC at 760 mmHg | |
| Molecular Formula | C15H13NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 190.8ºC | |
| Name | 2-[(3-methoxyphenyl)carbamoyl]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.324g/cm3 |
|---|---|
| Boiling Point | 391.9ºC at 760 mmHg |
| Molecular Formula | C15H13NO4 |
| Molecular Weight | 271.26800 |
| Flash Point | 190.8ºC |
| Exact Mass | 271.08400 |
| PSA | 79.12000 |
| LogP | 3.02970 |
| Vapour Pressure | 7.62E-07mmHg at 25°C |
| Index of Refraction | 1.646 |
| InChIKey | RKFAVXPUBJHXOI-UHFFFAOYSA-N |
| SMILES | COc1cccc(NC(=O)c2ccccc2C(=O)O)c1 |
| HS Code | 2924299090 |
|---|
|
~94%
2-[(3-methoxyph... CAS#:19336-97-1 |
| Literature: Perry, Christopher J.; Parveen, Zahida Journal of the Chemical Society. Perkin Transactions 2, 2001 , # 4 p. 512 - 521 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Benzoic acid,2-(((3-methoxyphenyl)amino)carbonyl) |
| MOPP and other combined chemotherapy including alkylating agents |
| m-Methoxyphenyl-N-phthalaminsaeure |
| 2-[(3-methoxyphenyl)aminocarbonyl]benzoic acid |