1,2,2-trimethyl-6-phenylpiperidin-4-one structure
|
Common Name | 1,2,2-trimethyl-6-phenylpiperidin-4-one | ||
|---|---|---|---|---|
| CAS Number | 19340-13-7 | Molecular Weight | 217.30700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H19NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,2,2-trimethyl-6-phenylpiperidin-4-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H19NO |
|---|---|
| Molecular Weight | 217.30700 |
| Exact Mass | 217.14700 |
| PSA | 20.31000 |
| LogP | 2.73890 |
| InChIKey | GMCQAJQFKVXPAT-UHFFFAOYSA-N |
| SMILES | CN1C(c2ccccc2)CC(=O)CC1(C)C |
|
~%
1,2,2-trimethyl... CAS#:19340-13-7 |
| Literature: Selvaraj; Venkateswaran; Ramarajan International Journal of Chemical Kinetics, 1994 , vol. 26, # 8 p. 847 - 855 |
|
~%
1,2,2-trimethyl... CAS#:19340-13-7 |
| Literature: Anker et al. Journal of the Chemical Society, 1945 , p. 917,919 |
| 1,2,2-Trimethyl-6-phenyl-4-piperidon |
| 1,2,2-trimethyl-6-phenyl-piperidin-4-one |
| 1,2,2-Trimethyl-6-phenyl-piperid-4-on |
| 4-Piperidinone,1,2,2-trimethyl-6-phenyl |
| 1,2,2-Trimethyl-6-phenyl-piperidin-4-on |
| 2,2-dimethyl-6-phenyl-N-methyl-4-piperidone |
| 1,2,2-Trimethyl-6-phenyl-4-piperidinone |