N,N-dicyclopentyl-3,9-dioxo-2,4,8,10-tetraoxa-3$l^C15H28N2O6P2,9$l^C15H28N2O6P2-diphosphas structure
|
Common Name | N,N-dicyclopentyl-3,9-dioxo-2,4,8,10-tetraoxa-3$l^C15H28N2O6P2,9$l^C15H28N2O6P2-diphosphas | ||
|---|---|---|---|---|
| CAS Number | 19341-50-5 | Molecular Weight | 394.34000 | |
| Density | 1.34g/cm3 | Boiling Point | 487.4ºC at 760 mmHg | |
| Molecular Formula | C15H28N2O6P2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 248.6ºC | |
| Name | 3-N,9-N-dicyclopentyl-3,9-dioxo-2,4,8,10-tetraoxa-3λ5,9λ5-diphosphaspiro[5.5]undecane-3,9-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.34g/cm3 |
|---|---|
| Boiling Point | 487.4ºC at 760 mmHg |
| Molecular Formula | C15H28N2O6P2 |
| Molecular Weight | 394.34000 |
| Flash Point | 248.6ºC |
| Exact Mass | 394.14200 |
| PSA | 114.74000 |
| LogP | 4.12880 |
| Vapour Pressure | 1.19E-09mmHg at 25°C |
| Index of Refraction | 1.532 |
| InChIKey | JFDORNIVHIOAEW-UHFFFAOYSA-N |
| SMILES | O=P1(NC2CCCC2)OCC2(CO1)COP(=O)(NC1CCCC1)OC2 |
|
~%
N,N-dicyclopent... CAS#:19341-50-5 |
| Literature: Billman; May Journal of pharmaceutical sciences, 1968 , vol. 57, # 10 p. 1812 - 1814 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3,9-Di-cyclopentylamin-2,4,8,10-tetraoxo-3,9-diphosphaspiro<5.5>undecan 3,9-dioxid |
| HMS3086G09 |
| n,n'-dicyclopentyl-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane-3,9-diamine 3,9-dioxide |