N,N-bis(4-chlorophenyl)-3,9-dioxo-2,4,8,10-tetraoxa-3$l^C17H18Cl2N2O6P2,9$l^C17H18Cl2N2O<s structure
|
Common Name | N,N-bis(4-chlorophenyl)-3,9-dioxo-2,4,8,10-tetraoxa-3$l^C17H18Cl2N2O6P2,9$l^C17H18Cl2N2O<s | ||
|---|---|---|---|---|
| CAS Number | 19341-53-8 | Molecular Weight | 479.18800 | |
| Density | 1.55g/cm3 | Boiling Point | 560.9ºC at 760 mmHg | |
| Molecular Formula | C17H18Cl2N2O6P2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 293ºC | |
| Name | 3-N,9-N-bis(4-chlorophenyl)-3,9-dioxo-2,4,8,10-tetraoxa-3λ5,9λ5-diphosphaspiro[5.5]undecane-3,9-diamine |
|---|
| Density | 1.55g/cm3 |
|---|---|
| Boiling Point | 560.9ºC at 760 mmHg |
| Molecular Formula | C17H18Cl2N2O6P2 |
| Molecular Weight | 479.18800 |
| Flash Point | 293ºC |
| Exact Mass | 478.00200 |
| PSA | 114.74000 |
| LogP | 5.95960 |
| Vapour Pressure | 1.31E-12mmHg at 25°C |
| Index of Refraction | 1.619 |
| InChIKey | ZUIPPSKEQCFEKO-UHFFFAOYSA-N |
| SMILES | O=P1(Nc2ccc(Cl)cc2)OCC2(CO1)COP(=O)(Nc1ccc(Cl)cc1)OC2 |
|
~%
N,N-bis(4-chlor... CAS#:19341-53-8 |
| Literature: Billman; May Journal of pharmaceutical sciences, 1968 , vol. 57, # 10 p. 1812 - 1814 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |