Isoquinoline-6-sulfonyl fluoride
Modify Date: 2026-07-07 18:23:51
Isoquinoline-6-sulfonyl fluoride structure
|
Common Name | Isoquinoline-6-sulfonyl fluoride | ||
|---|---|---|---|---|
| CAS Number | 1934467-56-7 | Molecular Weight | 211.21 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H6FNO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Isoquinoline-6-sulfonyl fluoride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H6FNO2S |
|---|---|
| Molecular Weight | 211.21 |
| InChIKey | OPTGZNFRKOIQSE-UHFFFAOYSA-N |
| SMILES | O=S(=O)(F)c1ccc2cnccc2c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of Isoquinoline-6-sulfonyl fluoride? |
| A: InChIKey of Isoquinoline-6-sulfonyl fluoride is OPTGZNFRKOIQSE-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1934467-56-7? |
| A: Chinese name of 1934467-56-7 is 1934467-56-7. |
| Q: What is the molecular formula of Isoquinoline-6-sulfonyl fluoride? |
| A: Molecular formula of Isoquinoline-6-sulfonyl fluoride is C9H6FNO2S. |
| Q: What is the English name of Isoquinoline-6-sulfonyl fluoride? |
| A: The English name of Isoquinoline-6-sulfonyl fluoride is Isoquinoline-6-sulfonyl fluoride. |
| Q: What is the SMILES notation of Isoquinoline-6-sulfonyl fluoride? |
| A: SMILES notation of Isoquinoline-6-sulfonyl fluoride is O=S(=O)(F)c1ccc2cnccc2c1. |
| Q: What is the molecular weight of Isoquinoline-6-sulfonyl fluoride? |
| A: Molecular weight of Isoquinoline-6-sulfonyl fluoride is 211.21. |
| Q: What is the CAS number of Isoquinoline-6-sulfonyl fluoride? |
| A: CAS number of Isoquinoline-6-sulfonyl fluoride is 1934467-56-7. |