4-{[(Tert-butoxy)carbonyl]amino}-5,5-difluoropentanoic acid
Modify Date: 2025-09-08 20:30:00
![4-{[(Tert-butoxy)carbonyl]amino}-5,5-difluoropentanoic acid Structure](https://www.chemsrc.com/extcaspic/041/1934913-37-7.png)
4-{[(Tert-butoxy)carbonyl]amino}-5,5-difluoropentanoic acid structure
|
Common Name | 4-{[(Tert-butoxy)carbonyl]amino}-5,5-difluoropentanoic acid | ||
|---|---|---|---|---|
| CAS Number | 1934913-37-7 | Molecular Weight | 253.24 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H17F2NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-{[(Tert-butoxy)carbonyl]amino}-5,5-difluoropentanoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H17F2NO4 |
|---|---|
| Molecular Weight | 253.24 |
| InChIKey | QQMVIXDQPWLOKT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CCC(=O)O)C(F)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 4-{[(Tert-butoxy)carbonyl]amino}-5,5-difluoropentanoic acid? |
| A: CAS number of 4-{[(Tert-butoxy)carbonyl]amino}-5,5-difluoropentanoic acid is 1934913-37-7. |
| Q: What is the InChIKey of 4-{[(Tert-butoxy)carbonyl]amino}-5,5-difluoropentanoic acid? |
| A: InChIKey of 4-{[(Tert-butoxy)carbonyl]amino}-5,5-difluoropentanoic acid is QQMVIXDQPWLOKT-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1934913-37-7? |
| A: Chinese name of 1934913-37-7 is 1934913-37-7. |
| Q: What is the molecular formula of 4-{[(Tert-butoxy)carbonyl]amino}-5,5-difluoropentanoic acid? |
| A: Molecular formula of 4-{[(Tert-butoxy)carbonyl]amino}-5,5-difluoropentanoic acid is C10H17F2NO4. |
| Q: What is the English name of 4-{[(Tert-butoxy)carbonyl]amino}-5,5-difluoropentanoic acid? |
| A: The English name of 4-{[(Tert-butoxy)carbonyl]amino}-5,5-difluoropentanoic acid is 4-{[(Tert-butoxy)carbonyl]amino}-5,5-difluoropentanoic acid. |
| Q: What is the molecular weight of 4-{[(Tert-butoxy)carbonyl]amino}-5,5-difluoropentanoic acid? |
| A: Molecular weight of 4-{[(Tert-butoxy)carbonyl]amino}-5,5-difluoropentanoic acid is 253.24. |
| Q: What is the SMILES notation of 4-{[(Tert-butoxy)carbonyl]amino}-5,5-difluoropentanoic acid? |
| A: SMILES notation of 4-{[(Tert-butoxy)carbonyl]amino}-5,5-difluoropentanoic acid is CC(C)(C)OC(=O)NC(CCC(=O)O)C(F)F. |