3,3'-(m-Tolylimino)bis(1-propanol)dicarbamate structure
|
Common Name | 3,3'-(m-Tolylimino)bis(1-propanol)dicarbamate | ||
|---|---|---|---|---|
| CAS Number | 19351-44-1 | Molecular Weight | 309.36100 | |
| Density | 1.203g/cm3 | Boiling Point | 570.1ºC at 760 mmHg | |
| Molecular Formula | C15H23N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 298.6ºC | |
| Name | 3-[N-(3-carbamoyloxypropyl)-3-methylanilino]propyl carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.203g/cm3 |
|---|---|
| Boiling Point | 570.1ºC at 760 mmHg |
| Molecular Formula | C15H23N3O4 |
| Molecular Weight | 309.36100 |
| Flash Point | 298.6ºC |
| Exact Mass | 309.16900 |
| PSA | 109.86000 |
| LogP | 2.79980 |
| Vapour Pressure | 5.2E-13mmHg at 25°C |
| Index of Refraction | 1.565 |
| InChIKey | CSCPQWKHIOFSHH-UHFFFAOYSA-N |
| SMILES | Cc1cccc(N(CCCOC(N)=O)CCCOC(N)=O)c1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| [(3-methylphenyl)imino]dipropane-3,1-diyl dicarbamate |
| 1-Propanol,3,3'-(m-tolylimino)di-,dicarbamate (ester) |
| I.S. 3244 |
| 3,3'-(m-Tolylimino)di-1-propanol dicarbamate (ester) |