5-Bromo-2,4-difluorobenzene-1-sulfonyl fluoride
Modify Date: 2025-09-10 10:11:56
5-Bromo-2,4-difluorobenzene-1-sulfonyl fluoride structure
|
Common Name | 5-Bromo-2,4-difluorobenzene-1-sulfonyl fluoride | ||
|---|---|---|---|---|
| CAS Number | 1935407-92-3 | Molecular Weight | 275.05 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H2BrF3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-Bromo-2,4-difluorobenzene-1-sulfonyl fluoride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C6H2BrF3O2S |
|---|---|
| Molecular Weight | 275.05 |
| InChIKey | UVALWBNSQBKHEN-UHFFFAOYSA-N |
| SMILES | O=S(=O)(F)c1cc(Br)c(F)cc1F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 5-Bromo-2,4-difluorobenzene-1-sulfonyl fluoride? |
| A: CAS number of 5-Bromo-2,4-difluorobenzene-1-sulfonyl fluoride is 1935407-92-3. |
| Q: What is the SMILES notation of 5-Bromo-2,4-difluorobenzene-1-sulfonyl fluoride? |
| A: SMILES notation of 5-Bromo-2,4-difluorobenzene-1-sulfonyl fluoride is O=S(=O)(F)c1cc(Br)c(F)cc1F. |
| Q: What is the InChIKey of 5-Bromo-2,4-difluorobenzene-1-sulfonyl fluoride? |
| A: InChIKey of 5-Bromo-2,4-difluorobenzene-1-sulfonyl fluoride is UVALWBNSQBKHEN-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 5-Bromo-2,4-difluorobenzene-1-sulfonyl fluoride? |
| A: Molecular weight of 5-Bromo-2,4-difluorobenzene-1-sulfonyl fluoride is 275.05. |
| Q: What is the English name of 5-Bromo-2,4-difluorobenzene-1-sulfonyl fluoride? |
| A: The English name of 5-Bromo-2,4-difluorobenzene-1-sulfonyl fluoride is 5-Bromo-2,4-difluorobenzene-1-sulfonyl fluoride. |
| Q: What is the Chinese name of 1935407-92-3? |
| A: Chinese name of 1935407-92-3 is 1935407-92-3. |
| Q: What is the molecular formula of 5-Bromo-2,4-difluorobenzene-1-sulfonyl fluoride? |
| A: Molecular formula of 5-Bromo-2,4-difluorobenzene-1-sulfonyl fluoride is C6H2BrF3O2S. |