2-(1,3-benzothiazol-2-ylcarbamoyl)benzoic acid
2-(1,3-benzothiazol-2-ylcarbamoyl)benzoic acid structure
|
Common Name | 2-(1,3-benzothiazol-2-ylcarbamoyl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 19357-13-2 | Molecular Weight | 298.31700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H10N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(1,3-benzothiazol-2-ylcarbamoyl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H10N2O3S |
|---|---|
| Molecular Weight | 298.31700 |
| Exact Mass | 298.04100 |
| PSA | 111.02000 |
| LogP | 3.63080 |
| InChIKey | JIVFQNKQKABOGB-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccccc1C(=O)Nc1nc2ccccc2s1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
2-(1,3-benzothi... CAS#:19357-13-2 |
| Literature: Sadek, Mohamed M. El; Essawi, Mohyi M. El; Baky, Samy A. Abdel Journal of Chemical & Engineering Data, 1989 , vol. 34, # 2 p. 257 - 259 |
![Benzo[d]thiazol-2-amine structure](https://image.chemsrc.com/caspic/040/136-95-8.png)
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Anti-osteoclastogenic activity in M-CSF/RANKL-induced C57BL/6 mouse BMDM cells assess...
Source: ChEMBL
Target: BMDM
External Id: CHEMBL5588172
|
|
Name: Cytotoxicity against mouse RAW264.7 cells incubated for 48 hrs by CCK-8 assay
Source: ChEMBL
Target: RAW264.7
External Id: CHEMBL5588173
|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Benzoic acid,2-[(2-benzothiazolylamino)carbonyl] |
| N-(2-Carboxybenzoyl)-2-aminobenzothiazole |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2-(1,3-benzothiazol-2-ylcarbamoyl)benzoic acid? |
| A: CAS number of 2-(1,3-benzothiazol-2-ylcarbamoyl)benzoic acid is 19357-13-2. |
| Q: What is the molecular formula of 2-(1,3-benzothiazol-2-ylcarbamoyl)benzoic acid? |
| A: Molecular formula of 2-(1,3-benzothiazol-2-ylcarbamoyl)benzoic acid is C15H10N2O3S. |
| Q: What is the polar surface area (PSA) of 2-(1,3-benzothiazol-2-ylcarbamoyl)benzoic acid? |
| A: Polar surface area (PSA) of 2-(1,3-benzothiazol-2-ylcarbamoyl)benzoic acid is 111.02000. |
| Q: What is the English name of 2-(1,3-benzothiazol-2-ylcarbamoyl)benzoic acid? |
| A: The English name of 2-(1,3-benzothiazol-2-ylcarbamoyl)benzoic acid is 2-(1,3-benzothiazol-2-ylcarbamoyl)benzoic acid. |
| Q: What is the SMILES notation of 2-(1,3-benzothiazol-2-ylcarbamoyl)benzoic acid? |
| A: SMILES notation of 2-(1,3-benzothiazol-2-ylcarbamoyl)benzoic acid is O=C(O)c1ccccc1C(=O)Nc1nc2ccccc2s1. |
| Q: What English synonyms does 2-(1,3-benzothiazol-2-ylcarbamoyl)benzoic acid have? |
| A: English synonyms of 2-(1,3-benzothiazol-2-ylcarbamoyl)benzoic acid: Benzoic acid,2-[(2-benzothiazolylamino)carbonyl], N-(2-Carboxybenzoyl)-2-aminobenzothiazole. |
| Q: What is the LogP of 2-(1,3-benzothiazol-2-ylcarbamoyl)benzoic acid? |
| A: LogP of 2-(1,3-benzothiazol-2-ylcarbamoyl)benzoic acid is 3.63080. |
| Q: What is the Chinese name of 19357-13-2? |
| A: Chinese name of 19357-13-2 is 19357-13-2. |
| Q: What is the molecular weight of 2-(1,3-benzothiazol-2-ylcarbamoyl)benzoic acid? |
| A: Molecular weight of 2-(1,3-benzothiazol-2-ylcarbamoyl)benzoic acid is 298.31700. |
| Q: What is the InChIKey of 2-(1,3-benzothiazol-2-ylcarbamoyl)benzoic acid? |
| A: InChIKey of 2-(1,3-benzothiazol-2-ylcarbamoyl)benzoic acid is JIVFQNKQKABOGB-UHFFFAOYSA-N. |