4-(2,5-dimethyl-1H-pyrrol-3-yl)but-3-en-2-amine
Modify Date: 2025-09-10 19:05:55
4-(2,5-dimethyl-1H-pyrrol-3-yl)but-3-en-2-amine structure
|
Common Name | 4-(2,5-dimethyl-1H-pyrrol-3-yl)but-3-en-2-amine | ||
|---|---|---|---|---|
| CAS Number | 1936407-13-4 | Molecular Weight | 164.25 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H16N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-(2,5-dimethyl-1H-pyrrol-3-yl)but-3-en-2-amine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H16N2 |
|---|---|
| Molecular Weight | 164.25 |
| InChIKey | CFSFZSVYYBLGRU-SNAWJCMRSA-N |
| SMILES | Cc1cc(C=CC(C)N)c(C)[nH]1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 4-(2,5-dimethyl-1H-pyrrol-3-yl)but-3-en-2-amine? |
| A: CAS number of 4-(2,5-dimethyl-1H-pyrrol-3-yl)but-3-en-2-amine is 1936407-13-4. |
| Q: What is the molecular formula of 4-(2,5-dimethyl-1H-pyrrol-3-yl)but-3-en-2-amine? |
| A: Molecular formula of 4-(2,5-dimethyl-1H-pyrrol-3-yl)but-3-en-2-amine is C10H16N2. |
| Q: What is the Chinese name of 1936407-13-4? |
| A: Chinese name of 1936407-13-4 is 1936407-13-4. |
| Q: What is the molecular weight of 4-(2,5-dimethyl-1H-pyrrol-3-yl)but-3-en-2-amine? |
| A: Molecular weight of 4-(2,5-dimethyl-1H-pyrrol-3-yl)but-3-en-2-amine is 164.25. |
| Q: What is the InChIKey of 4-(2,5-dimethyl-1H-pyrrol-3-yl)but-3-en-2-amine? |
| A: InChIKey of 4-(2,5-dimethyl-1H-pyrrol-3-yl)but-3-en-2-amine is CFSFZSVYYBLGRU-SNAWJCMRSA-N. |
| Q: What is the English name of 4-(2,5-dimethyl-1H-pyrrol-3-yl)but-3-en-2-amine? |
| A: The English name of 4-(2,5-dimethyl-1H-pyrrol-3-yl)but-3-en-2-amine is 4-(2,5-dimethyl-1H-pyrrol-3-yl)but-3-en-2-amine. |
| Q: What is the SMILES notation of 4-(2,5-dimethyl-1H-pyrrol-3-yl)but-3-en-2-amine? |
| A: SMILES notation of 4-(2,5-dimethyl-1H-pyrrol-3-yl)but-3-en-2-amine is Cc1cc(C=CC(C)N)c(C)[nH]1. |