GW2GD2S2HK
Modify Date: 2025-09-11 17:04:15
GW2GD2S2HK structure
|
Common Name | GW2GD2S2HK | ||
|---|---|---|---|---|
| CAS Number | 1936472-44-4 | Molecular Weight | 379.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H11F2N7O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | GW2GD2S2HK |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H11F2N7O |
|---|---|
| Molecular Weight | 379.3 |
| InChIKey | JCVFQQMQKIWKOV-UHFFFAOYSA-N |
| SMILES | O=c1ccc2cc(C(F)(F)c3nnc4ccc(-c5cn[nH]c5)nn34)ccc2[nH]1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of GW2GD2S2HK? |
| A: InChIKey of GW2GD2S2HK is JCVFQQMQKIWKOV-UHFFFAOYSA-N. |
| Q: What is the CAS number of GW2GD2S2HK? |
| A: CAS number of GW2GD2S2HK is 1936472-44-4. |
| Q: What is the molecular weight of GW2GD2S2HK? |
| A: Molecular weight of GW2GD2S2HK is 379.3. |
| Q: What is the English name of GW2GD2S2HK? |
| A: The English name of GW2GD2S2HK is GW2GD2S2HK. |
| Q: What is the molecular formula of GW2GD2S2HK? |
| A: Molecular formula of GW2GD2S2HK is C18H11F2N7O. |
| Q: What is the SMILES notation of GW2GD2S2HK? |
| A: SMILES notation of GW2GD2S2HK is O=c1ccc2cc(C(F)(F)c3nnc4ccc(-c5cn[nH]c5)nn34)ccc2[nH]1. |
| Q: What is the Chinese name of 1936472-44-4? |
| A: Chinese name of 1936472-44-4 is 1936472-44-4. |