2-bromo-1-(3-phenylmethoxyphenyl)ethanone structure
|
Common Name | 2-bromo-1-(3-phenylmethoxyphenyl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 19381-40-9 | Molecular Weight | 305.16700 | |
| Density | 1.394g/cm3 | Boiling Point | 395.5ºC at 760mmHg | |
| Molecular Formula | C15H13BrO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 193ºC | |
| Name | 2-bromo-1-(3-phenylmethoxyphenyl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.394g/cm3 |
|---|---|
| Boiling Point | 395.5ºC at 760mmHg |
| Molecular Formula | C15H13BrO2 |
| Molecular Weight | 305.16700 |
| Flash Point | 193ºC |
| Exact Mass | 304.01000 |
| PSA | 26.30000 |
| LogP | 3.84320 |
| Vapour Pressure | 1.83E-06mmHg at 25°C |
| Index of Refraction | 1.603 |
| InChIKey | GFZOJLIHCWKKPR-UHFFFAOYSA-N |
| SMILES | O=C(CBr)c1cccc(OCc2ccccc2)c1 |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| bromomethyl 3-benzyloxyphenol ketone |
| m-benzyloxyphenacyl bromide |
| EINECS 243-009-7 |
| 1-[3-(benzyloxy)phenyl]-2-bromoethanone |
| 2-(3-benzyloxyphenyl)-2-oxoethyl bromide |
| 2-bromo-1-(3-benzyloxyphenyl)ethanone |
| 2-Bromo-1-(3-(phenylmethoxy)phenyl)ethan-1-one |