tert-butyl 3-formyl-2-phenylindole-1-carboxylate structure
|
Common Name | tert-butyl 3-formyl-2-phenylindole-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 193810-67-2 | Molecular Weight | 321.37000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H19NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tert-butyl 3-formyl-2-phenylindole-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C20H19NO3 |
|---|---|
| Molecular Weight | 321.37000 |
| Exact Mass | 321.13600 |
| PSA | 48.30000 |
| LogP | 4.90400 |
| InChIKey | IXYDAAFQLPLAKD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)n1c(-c2ccccc2)c(C=O)c2ccccc21 |
|
~99%
tert-butyl 3-fo... CAS#:193810-67-2 |
| Literature: Lee, Jong Seok; Shin, Junho; Lee, Hyi-Seung; Shin, Hee Jae; Lee, Yeon-Ju Bulletin of the Korean Chemical Society, 2013 , vol. 34, # 2 p. 357 - 358 |
| 1H-Indole-1-carboxylic acid,3-formyl-2-phenyl-,1,1-dimethylethyl ester |
| 1-tert-butoxycarbonyl-3-formyl-2-phenylindole |
| tert-butyl 3-formyl-2-phenyl-1H-indole-1-carboxylate |