Triallyl(3-chloropropyl)silane
Modify Date: 2025-09-11 14:19:08
Triallyl(3-chloropropyl)silane structure
|
Common Name | Triallyl(3-chloropropyl)silane | ||
|---|---|---|---|---|
| CAS Number | 193828-85-2 | Molecular Weight | 228.83400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H21ClSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Triallyl(3-chloropropyl)silane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H21ClSi |
|---|---|
| Molecular Weight | 228.83400 |
| Exact Mass | 228.11000 |
| LogP | 4.62210 |
| InChIKey | TVELLBBVQONKLT-UHFFFAOYSA-N |
| SMILES | C=CC[Si](CC=C)(CC=C)CCCCl |
|
~96%
Triallyl(3-chlo... CAS#:193828-85-2 |
| Literature: Industry-Academic Cooperation Foundation Yonsei University Patent: US2009/270590 A1, 2009 ; Location in patent: Page/Page column 6 ; |
|
~70%
Triallyl(3-chlo... CAS#:193828-85-2 |
| Literature: Ahmad, Iftikhar; Falck-Pedersen, Mette Lene; Undheim, Kjell Journal of Organometallic Chemistry, 2001 , vol. 625, # 2 p. 160 - 172 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1-Chlor-3-dichlorphosphinylpropan |
| 3-chloropropyl-triallyl-silane |
| Phosphonic dichloride,(3-chloropropyl) |
| 3-chloropropylphosphonic dichloride |
| 3-Chlor-propan-phosphonsaeure-(1)-dichlorid |
| dichloride of 3-chloropropylphosphonic acid |
| (3-chloro-propyl)-phosphonic acid-dichloride |
| (3-Chlor-propyl)-phosphonsaeure-dichlorid |