2-Butenamide,N-[3-(trifluoromethyl)phenyl]- structure
|
Common Name | 2-Butenamide,N-[3-(trifluoromethyl)phenyl]- | ||
|---|---|---|---|---|
| CAS Number | 1939-18-0 | Molecular Weight | 229.19800 | |
| Density | 1.254g/cm3 | Boiling Point | 318.8ºC at 760mmHg | |
| Molecular Formula | C11H10F3NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 146.6ºC | |
| Name | (E)-N-[3-(trifluoromethyl)phenyl]but-2-enamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.254g/cm3 |
|---|---|
| Boiling Point | 318.8ºC at 760mmHg |
| Molecular Formula | C11H10F3NO |
| Molecular Weight | 229.19800 |
| Flash Point | 146.6ºC |
| Exact Mass | 229.07100 |
| PSA | 29.10000 |
| LogP | 3.29300 |
| Vapour Pressure | 0.000353mmHg at 25°C |
| Index of Refraction | 1.512 |
| InChIKey | YMUJNXBVYSCKFI-DUXPYHPUSA-N |
| SMILES | CC=CC(=O)Nc1cccc(C(F)(F)F)c1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| hms2570m05 |
| hms1580n11 |