2-PHENYL-2-(PIPERIDIN-2-YL)ACETAMIDE structure
|
Common Name | 2-PHENYL-2-(PIPERIDIN-2-YL)ACETAMIDE | ||
|---|---|---|---|---|
| CAS Number | 19395-39-2 | Molecular Weight | 218.29500 | |
| Density | 1.097 g/cm3 | Boiling Point | 406.6ºC at 760 mmHg | |
| Molecular Formula | C13H18N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 199.7ºC | |
| Name | 2-phenyl-2-piperidin-2-ylacetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.097 g/cm3 |
|---|---|
| Boiling Point | 406.6ºC at 760 mmHg |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.29500 |
| Flash Point | 199.7ºC |
| Exact Mass | 218.14200 |
| PSA | 55.12000 |
| LogP | 2.42670 |
| Vapour Pressure | 8.01E-07mmHg at 25°C |
| Index of Refraction | 1.554 |
| InChIKey | LJLMNWPXAYKPGV-UHFFFAOYSA-N |
| SMILES | NC(=O)C(c1ccccc1)C1CCCCN1 |
| HS Code | 2933399090 |
|---|
|
~80%
2-PHENYL-2-(PIP... CAS#:19395-39-2 |
| Literature: Chavan, Anil B.; Gundecha, Sachin S.; Kadam, Pramod N.; Maikap, Golak C.; Gurjar, Mukund K. Organic Process Research and Development, 2010 , vol. 14, # 6 p. 1473 - 1475 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Ritalinic Acid Amide |
| EINECS 243-019-1 |
| 2-Phenyl-2-(piperidin-2-yl)acetamide |
| 2-Phenyl-2-(2-piperidyl)acetaMide Hydrate |
| erythro/threo-2-phenyl-2-piperidine-2-yl acetamide |
| 2-phenyl-2-piperidin-2-yl-acetamide |