Inosine, O-methyloxime structure
|
Common Name | Inosine, O-methyloxime | ||
|---|---|---|---|---|
| CAS Number | 19399-25-8 | Molecular Weight | 297.26700 | |
| Density | 1.88g/cm3 | Boiling Point | 609.8ºC at 760 mmHg | |
| Molecular Formula | C11H15N5O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 322.6ºC | |
| Name | N4-Methoxyadenosine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.88g/cm3 |
|---|---|
| Boiling Point | 609.8ºC at 760 mmHg |
| Molecular Formula | C11H15N5O5 |
| Molecular Weight | 297.26700 |
| Flash Point | 322.6ºC |
| Exact Mass | 297.10700 |
| PSA | 138.01000 |
| Vapour Pressure | 1.01E-15mmHg at 25°C |
| Index of Refraction | 1.791 |
| InChIKey | JVEJHUJMDIDUDS-UHFFFAOYSA-N |
| SMILES | CONc1ncnc2c1ncn2C1OC(CO)C(O)C1O |
|
~11%
Inosine, O-meth... CAS#:19399-25-8 |
| Literature: Fujii; Saito; Kizu; Hayashibara; Kumazawa; Nakajima; Fujisawa Chemical and Pharmaceutical Bulletin, 1991 , vol. 39, # 2 p. 301 - 308 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| 6-Methoxyamino-purinribosid |
| 6-O-methyladenosine |
| N(6)-methoxyadenosine |