Benzene, 1,1-methylenebis[4-bromo
Benzene, 1,1-methylenebis[4-bromo structure
|
Common Name | Benzene, 1,1-methylenebis[4-bromo | ||
|---|---|---|---|---|
| CAS Number | 1941-86-2 | Molecular Weight | 326.02600 | |
| Density | 1.62g/cm3 | Boiling Point | 369.9ºC at 760 mmHg | |
| Molecular Formula | C13H10Br2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 207.3ºC | |
Summary: 1-Bromo-4-[(4-bromophenyl)methyl]benzene (Chinese name: 1-溴-4-[(4-溴苯基)甲基]苯，CAS number: 1941-86-2，molecular formula: C13H10Br2，molecular weight: 326.03)，for research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-bromo-4-[(4-bromophenyl)methyl]benzene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.62g/cm3 |
|---|---|
| Boiling Point | 369.9ºC at 760 mmHg |
| Molecular Formula | C13H10Br2 |
| Molecular Weight | 326.02600 |
| Flash Point | 207.3ºC |
| Exact Mass | 323.91500 |
| LogP | 4.80240 |
| Vapour Pressure | 2.45E-05mmHg at 25°C |
| Index of Refraction | 1.622 |
| InChIKey | IYOYOEKCRDEIPQ-UHFFFAOYSA-N |
| SMILES | Brc1ccc(Cc2ccc(Br)cc2)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 9 | |
|---|---|
| DownStream 6 | |
CAS#:3988-03-2
CAS#:29334-18-7
CAS#:2990-17-2
CAS#:55883-45-9
CAS#:106-37-6
CAS#:1122-91-4
CAS#:107-15-3
CAS#:233598-97-5
CAS#:233599-01-4![1-methylsulfanyl-4-[(4-methylsulfanylphenyl)methyl]benzene structure](https://image.chemsrc.com/caspic/053/22276-28-4.png)
CAS#:22276-28-4
CAS#:101-81-5
CAS#:572910-05-5
CAS#:10466-37-2This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| p,p'-dibromodiphenylmethane |
| 4,4'-Dibromdiphenylmethan |
| 4,4'-dibromodiphenylmethane |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the boiling point of 1-bromo-4-[(4-bromophenyl)methyl]benzene? |
| A: Boiling point of 1-bromo-4-[(4-bromophenyl)methyl]benzene is 369.9ºC at 760 mmHg. |
| Q: What English synonyms does 1-bromo-4-[(4-bromophenyl)methyl]benzene have? |
| A: English synonyms of 1-bromo-4-[(4-bromophenyl)methyl]benzene: p,p'-dibromodiphenylmethane, 4,4'-Dibromdiphenylmethan, 4,4'-dibromodiphenylmethane. |
| Q: What is the InChIKey of 1-bromo-4-[(4-bromophenyl)methyl]benzene? |
| A: InChIKey of 1-bromo-4-[(4-bromophenyl)methyl]benzene is IYOYOEKCRDEIPQ-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 1-bromo-4-[(4-bromophenyl)methyl]benzene? |
| A: Molecular formula of 1-bromo-4-[(4-bromophenyl)methyl]benzene is C13H10Br2. |
| Q: What are the upstream materials of 1-bromo-4-[(4-bromophenyl)methyl]benzene? |
| A: Related upstream materials(CAS) of 1-bromo-4-[(4-bromophenyl)methyl]benzene: 3988-03-2;29334-18-7;2990-17-2;55883-45-9;106-37-6;1122-91-4;107-15-3;233598-97-5;233599-01-4. |
| Q: What is the molecular weight of 1-bromo-4-[(4-bromophenyl)methyl]benzene? |
| A: Molecular weight of 1-bromo-4-[(4-bromophenyl)methyl]benzene is 326.02600. |
| Q: What is the LogP of 1-bromo-4-[(4-bromophenyl)methyl]benzene? |
| A: LogP of 1-bromo-4-[(4-bromophenyl)methyl]benzene is 4.80240. |
| Q: What is the SMILES notation of 1-bromo-4-[(4-bromophenyl)methyl]benzene? |
| A: SMILES notation of 1-bromo-4-[(4-bromophenyl)methyl]benzene is Brc1ccc(Cc2ccc(Br)cc2)cc1. |
| Q: What are the downstream products of 1-bromo-4-[(4-bromophenyl)methyl]benzene? |
| A: Related downstream products(CAS) of 1-bromo-4-[(4-bromophenyl)methyl]benzene: 22276-28-4;101-81-5;572910-05-5;10466-37-2;3988-03-2;29334-18-7. |
| Q: What is the Chinese name of 1941-86-2? |
| A: Chinese name of 1941-86-2 is 1941-86-2. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |