2-(4-tert-butylphenoxy)cyclohexanol structure
|
Common Name | 2-(4-tert-butylphenoxy)cyclohexanol | ||
|---|---|---|---|---|
| CAS Number | 1942-71-8 | Molecular Weight | 248.361 | |
| Density | 1.036g/cm3 | Boiling Point | 365.686°C at 760 mmHg | |
| Molecular Formula | C16H24O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 150.652°C | |
Use of 2-(4-tert-butylphenoxy)cyclohexanolA novel potent, selective Y4R positive allosteric modulator (EC50=5.1 uM) that potentiates Y4R activation in G-protein signaling and arrestin3 recruitment experiments. |
| Name | 2-(4-tert-butylphenoxy)cyclohexanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.036g/cm3 |
|---|---|
| Boiling Point | 365.686°C at 760 mmHg |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.361 |
| Flash Point | 150.652°C |
| Exact Mass | 248.177628 |
| PSA | 29.46000 |
| LogP | 4.14 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.529 |
| InChIKey | FTIXUILRMBSXNS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(OC2CCCCC2O)cc1 |
| HS Code | 2909499000 |
|---|
|
~70%
2-(4-tert-butyl... CAS#:1942-71-8 |
| Literature: Basavaiah, D.; Krishna, P. Rama; Bharathi, T. K. Tetrahedron Letters, 1990 , vol. 31, # 30 p. 4347 - 4348 |
|
~65%
2-(4-tert-butyl... CAS#:1942-71-8 |
| Literature: Basavaiah, Deevi; Krishna, Peddinti Rama; Bharathi, Tirumala K. Tetrahedron: Asymmetry, 1995 , vol. 6, # 2 p. 439 - 454 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2909499000 |
|---|---|
| Summary | 2909499000. ether-alcohols and their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:5.5%. General tariff:30.0% |
| 2-(P-T-BUTYLPHENOXY)CYCLOHEXANOL |
| Cyclohexanol, 2-(4-(1,1-dimethylethyl)phenoxy)- |
| propargite metab. |
| 2-[4-(2-Methyl-2-propanyl)phenoxy]cyclohexanol |
| 2-(4-tert-Butylphenoxy)cyclohexanol |
| Cyclohexanol, 2-(p-tert-butylphenoxy)- |
| Cyclohexanol, 2-[4-(1,1-dimethylethyl)phenoxy]- |