ethyl-3-(4-formylphenyl) benzoate structure
|
Common Name | ethyl-3-(4-formylphenyl) benzoate | ||
|---|---|---|---|---|
| CAS Number | 194367-78-7 | Molecular Weight | 254.28100 | |
| Density | 1.114g/cm3 | Boiling Point | 418.6ºC at 760 mmHg | |
| Molecular Formula | C16H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 185.3ºC | |
| Name | ethyl-3-(4-formylphenyl) benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.114g/cm3 |
|---|---|
| Boiling Point | 418.6ºC at 760 mmHg |
| Molecular Formula | C16H14O3 |
| Molecular Weight | 254.28100 |
| Flash Point | 185.3ºC |
| Exact Mass | 254.09400 |
| PSA | 43.37000 |
| LogP | 3.34280 |
| Vapour Pressure | 3.24E-07mmHg at 25°C |
| Index of Refraction | 1.555 |
| InChIKey | PGDYFVYPQHZDDD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cccc(-c2ccc(C=O)cc2)c1 |
| HS Code | 2918300090 |
|---|
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Benzenecarboximidic acid,4-formyl-,ethyl ester,hydrochloride |
| Ethyl 4'-formyl-[1,1'-biphenyl]-3-carboxylate |
| ethyl 4'-formylbiphenyl-3-carboxylate |
| ethyl 4-formylbenzimidate hydrochloride |