4-{1-[2-(Cyclopentanesulfonyl)acetyl]piperidin-4-yl}-3,3-dimethylazetidin-2-one structure
|
Common Name | 4-{1-[2-(Cyclopentanesulfonyl)acetyl]piperidin-4-yl}-3,3-dimethylazetidin-2-one | ||
|---|---|---|---|---|
| CAS Number | 1945382-56-8 | Molecular Weight | 356.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H28N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-{1-[2-(Cyclopentanesulfonyl)acetyl]piperidin-4-yl}-3,3-dimethylazetidin-2-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H28N2O4S |
|---|---|
| Molecular Weight | 356.5 |
| InChIKey | OGKFRTZHNIAQDQ-UHFFFAOYSA-N |
| SMILES | CC1(C)C(=O)NC1C1CCN(C(=O)CS(=O)(=O)C2CCCC2)CC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 4-{1-[2-(Cyclopentanesulfonyl)acetyl]piperidin-4-yl}-3,3-dimethylazetidin-2-one? |
| A: Molecular weight of 4-{1-[2-(Cyclopentanesulfonyl)acetyl]piperidin-4-yl}-3,3-dimethylazetidin-2-one is 356.5. |
| Q: What is the SMILES notation of 4-{1-[2-(Cyclopentanesulfonyl)acetyl]piperidin-4-yl}-3,3-dimethylazetidin-2-one? |
| A: SMILES notation of 4-{1-[2-(Cyclopentanesulfonyl)acetyl]piperidin-4-yl}-3,3-dimethylazetidin-2-one is CC1(C)C(=O)NC1C1CCN(C(=O)CS(=O)(=O)C2CCCC2)CC1. |
| Q: What is the molecular formula of 4-{1-[2-(Cyclopentanesulfonyl)acetyl]piperidin-4-yl}-3,3-dimethylazetidin-2-one? |
| A: Molecular formula of 4-{1-[2-(Cyclopentanesulfonyl)acetyl]piperidin-4-yl}-3,3-dimethylazetidin-2-one is C17H28N2O4S. |
| Q: What is the InChIKey of 4-{1-[2-(Cyclopentanesulfonyl)acetyl]piperidin-4-yl}-3,3-dimethylazetidin-2-one? |
| A: InChIKey of 4-{1-[2-(Cyclopentanesulfonyl)acetyl]piperidin-4-yl}-3,3-dimethylazetidin-2-one is OGKFRTZHNIAQDQ-UHFFFAOYSA-N. |
| Q: What is the CAS number of 4-{1-[2-(Cyclopentanesulfonyl)acetyl]piperidin-4-yl}-3,3-dimethylazetidin-2-one? |
| A: CAS number of 4-{1-[2-(Cyclopentanesulfonyl)acetyl]piperidin-4-yl}-3,3-dimethylazetidin-2-one is 1945382-56-8. |
| Q: What is the English name of 4-{1-[2-(Cyclopentanesulfonyl)acetyl]piperidin-4-yl}-3,3-dimethylazetidin-2-one? |
| A: The English name of 4-{1-[2-(Cyclopentanesulfonyl)acetyl]piperidin-4-yl}-3,3-dimethylazetidin-2-one is 4-{1-[2-(Cyclopentanesulfonyl)acetyl]piperidin-4-yl}-3,3-dimethylazetidin-2-one. |
| Q: What is the Chinese name of 1945382-56-8? |
| A: Chinese name of 1945382-56-8 is 1945382-56-8. |