Rubrosteron structure
|
Common Name | Rubrosteron | ||
|---|---|---|---|---|
| CAS Number | 19466-41-2 | Molecular Weight | 334.41 | |
| Density | 1.34g/cm3 | Boiling Point | 540.7ºC at 760mmHg | |
| Molecular Formula | C19H26O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 294.8ºC | |
Use of RubrosteronRubrosterone is a metabolite of insect metamorphosing substances, that can be isolated from Achyranthes rubrofuca and A. fmaiei (Amaranthaceae)[1]. |
| Name | Rubrosterone |
|---|---|
| Synonym | More Synonyms |
| Description | Rubrosterone is a metabolite of insect metamorphosing substances, that can be isolated from Achyranthes rubrofuca and A. fmaiei (Amaranthaceae)[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.34g/cm3 |
|---|---|
| Boiling Point | 540.7ºC at 760mmHg |
| Molecular Formula | C19H26O5 |
| Molecular Weight | 334.41 |
| Flash Point | 294.8ºC |
| Exact Mass | 334.17800 |
| PSA | 94.83000 |
| LogP | 1.14390 |
| Vapour Pressure | 6.06E-14mmHg at 25°C |
| Index of Refraction | 1.609 |
| InChIKey | OMQCWEJQYPUGJG-UHFFFAOYSA-N |
| SMILES | CC12CC(O)C(O)CC1C(=O)C=C1C2CCC2(C)C(=O)CCC12O |
| Rubrosteron |