Ccris 7861
Modify Date: 2025-09-04 18:52:18
Ccris 7861 structure
|
Common Name | Ccris 7861 | ||
|---|---|---|---|---|
| CAS Number | 194673-71-7 | Molecular Weight | 432.2 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C5H12Cl2NO3PtS+ | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Ccris 7861 |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C5H12Cl2NO3PtS+ |
|---|---|
| Molecular Weight | 432.2 |
| InChIKey | MGMMTCASCFSWGP-KFNKXJKFSA-M |
| SMILES | CS(=O)CCC(N)C(=O)O.Cl[Pt]Cl.[H+] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 194673-71-7? |
| A: Chinese name of 194673-71-7 is 194673-71-7. |
| Q: What is the molecular weight of Ccris 7861? |
| A: Molecular weight of Ccris 7861 is 432.2. |
| Q: What is the CAS number of Ccris 7861? |
| A: CAS number of Ccris 7861 is 194673-71-7. |
| Q: What is the English name of Ccris 7861? |
| A: The English name of Ccris 7861 is Ccris 7861. |
| Q: What is the molecular formula of Ccris 7861? |
| A: Molecular formula of Ccris 7861 is C5H12Cl2NO3PtS+. |
| Q: What is the InChIKey of Ccris 7861? |
| A: InChIKey of Ccris 7861 is MGMMTCASCFSWGP-KFNKXJKFSA-M. |
| Q: What is the SMILES notation of Ccris 7861? |
| A: SMILES notation of Ccris 7861 is CS(=O)CCC(N)C(=O)O.Cl[Pt]Cl.[H+]. |