5-(1-butyl-1H-pyrazol-3-yl)-1,3,4-thiadiazol-2-amine
Modify Date: 2025-09-10 11:27:45
5-(1-butyl-1H-pyrazol-3-yl)-1,3,4-thiadiazol-2-amine structure
|
Common Name | 5-(1-butyl-1H-pyrazol-3-yl)-1,3,4-thiadiazol-2-amine | ||
|---|---|---|---|---|
| CAS Number | 1946812-22-1 | Molecular Weight | 223.30 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H13N5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-(1-butyl-1H-pyrazol-3-yl)-1,3,4-thiadiazol-2-amine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H13N5S |
|---|---|
| Molecular Weight | 223.30 |
| InChIKey | MPQFBXHQZZMGQC-UHFFFAOYSA-N |
| SMILES | CCCCn1ccc(-c2nnc(N)s2)n1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 5-(1-butyl-1H-pyrazol-3-yl)-1,3,4-thiadiazol-2-amine? |
| A: SMILES notation of 5-(1-butyl-1H-pyrazol-3-yl)-1,3,4-thiadiazol-2-amine is CCCCn1ccc(-c2nnc(N)s2)n1. |
| Q: What is the Chinese name of 1946812-22-1? |
| A: Chinese name of 1946812-22-1 is 1946812-22-1. |
| Q: What is the molecular formula of 5-(1-butyl-1H-pyrazol-3-yl)-1,3,4-thiadiazol-2-amine? |
| A: Molecular formula of 5-(1-butyl-1H-pyrazol-3-yl)-1,3,4-thiadiazol-2-amine is C9H13N5S. |
| Q: What is the CAS number of 5-(1-butyl-1H-pyrazol-3-yl)-1,3,4-thiadiazol-2-amine? |
| A: CAS number of 5-(1-butyl-1H-pyrazol-3-yl)-1,3,4-thiadiazol-2-amine is 1946812-22-1. |
| Q: What is the InChIKey of 5-(1-butyl-1H-pyrazol-3-yl)-1,3,4-thiadiazol-2-amine? |
| A: InChIKey of 5-(1-butyl-1H-pyrazol-3-yl)-1,3,4-thiadiazol-2-amine is MPQFBXHQZZMGQC-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 5-(1-butyl-1H-pyrazol-3-yl)-1,3,4-thiadiazol-2-amine? |
| A: Molecular weight of 5-(1-butyl-1H-pyrazol-3-yl)-1,3,4-thiadiazol-2-amine is 223.30. |
| Q: What is the English name of 5-(1-butyl-1H-pyrazol-3-yl)-1,3,4-thiadiazol-2-amine? |
| A: The English name of 5-(1-butyl-1H-pyrazol-3-yl)-1,3,4-thiadiazol-2-amine is 5-(1-butyl-1H-pyrazol-3-yl)-1,3,4-thiadiazol-2-amine. |