3-Iodo-1,5-dimethyl-1H-pyrazole-4-sulfonyl chloride
Modify Date: 2026-08-29 18:20:31
3-Iodo-1,5-dimethyl-1H-pyrazole-4-sulfonyl chloride structure
|
Common Name | 3-Iodo-1,5-dimethyl-1H-pyrazole-4-sulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 1946812-62-9 | Molecular Weight | 320.54 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C5H6ClIN2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-Iodo-1,5-dimethyl-1H-pyrazole-4-sulfonyl chloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C5H6ClIN2O2S |
|---|---|
| Molecular Weight | 320.54 |
| InChIKey | TZVKXCYXDXYOHS-UHFFFAOYSA-N |
| SMILES | Cc1c(S(=O)(=O)Cl)c(I)nn1C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 3-Iodo-1,5-dimethyl-1H-pyrazole-4-sulfonyl chloride? |
| A: Molecular formula of 3-Iodo-1,5-dimethyl-1H-pyrazole-4-sulfonyl chloride is C5H6ClIN2O2S. |
| Q: What is the CAS number of 3-Iodo-1,5-dimethyl-1H-pyrazole-4-sulfonyl chloride? |
| A: CAS number of 3-Iodo-1,5-dimethyl-1H-pyrazole-4-sulfonyl chloride is 1946812-62-9. |
| Q: What is the Chinese name of 1946812-62-9? |
| A: Chinese name of 1946812-62-9 is 1946812-62-9. |
| Q: What is the SMILES notation of 3-Iodo-1,5-dimethyl-1H-pyrazole-4-sulfonyl chloride? |
| A: SMILES notation of 3-Iodo-1,5-dimethyl-1H-pyrazole-4-sulfonyl chloride is Cc1c(S(=O)(=O)Cl)c(I)nn1C. |
| Q: What is the InChIKey of 3-Iodo-1,5-dimethyl-1H-pyrazole-4-sulfonyl chloride? |
| A: InChIKey of 3-Iodo-1,5-dimethyl-1H-pyrazole-4-sulfonyl chloride is TZVKXCYXDXYOHS-UHFFFAOYSA-N. |
| Q: What is the English name of 3-Iodo-1,5-dimethyl-1H-pyrazole-4-sulfonyl chloride? |
| A: The English name of 3-Iodo-1,5-dimethyl-1H-pyrazole-4-sulfonyl chloride is 3-Iodo-1,5-dimethyl-1H-pyrazole-4-sulfonyl chloride. |
| Q: What is the molecular weight of 3-Iodo-1,5-dimethyl-1H-pyrazole-4-sulfonyl chloride? |
| A: Molecular weight of 3-Iodo-1,5-dimethyl-1H-pyrazole-4-sulfonyl chloride is 320.54. |