ACPT-1 structure
|
Common Name | ACPT-1 | ||
|---|---|---|---|---|
| CAS Number | 194918-76-8 | Molecular Weight | 217.17600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H11NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of ACPT-1rel-ACPT-I is an agonist of group III mGluRs with diverse biological activities including neuroprotective, anticonvulsant, and anxiolytic-like effects[1][2][3][4][5]. |
| Name | acpt-i |
|---|
| Description | rel-ACPT-I is an agonist of group III mGluRs with diverse biological activities including neuroprotective, anticonvulsant, and anxiolytic-like effects[1][2][3][4][5]. |
|---|---|
| References |
| Molecular Formula | C8H11NO6 |
|---|---|
| Molecular Weight | 217.17600 |
| Exact Mass | 217.05900 |
| PSA | 137.92000 |
| InChIKey | FERIKTBTNCSGJS-OBLUMXEWSA-N |
| SMILES | NC1(C(=O)O)CC(C(=O)O)C(C(=O)O)C1 |