6-Chloro-7-hydroxy-4-methylcoumarin structure
|
Common Name | 6-Chloro-7-hydroxy-4-methylcoumarin | ||
|---|---|---|---|---|
| CAS Number | 19492-02-5 | Molecular Weight | 210.61400 | |
| Density | 1.447g/cm3 | Boiling Point | 388.7ºC at 760mmHg | |
| Molecular Formula | C10H7ClO3 | Melting Point | 278ºC | |
| MSDS | N/A | Flash Point | 188.9ºC | |
Use of 6-Chloro-7-hydroxy-4-methylcoumarin6-Chloro-7-hydroxy-4-methylcoumarin (compound 3) an intermediate of pharmaceutical synthesis[1]. |
| Name | 6-chloro-7-hydroxy-4-methylchromen-2-one |
|---|---|
| Synonym | More Synonyms |
| Description | 6-Chloro-7-hydroxy-4-methylcoumarin (compound 3) an intermediate of pharmaceutical synthesis[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.447g/cm3 |
|---|---|
| Boiling Point | 388.7ºC at 760mmHg |
| Melting Point | 278ºC |
| Molecular Formula | C10H7ClO3 |
| Molecular Weight | 210.61400 |
| Flash Point | 188.9ºC |
| Exact Mass | 210.00800 |
| PSA | 50.44000 |
| LogP | 2.46040 |
| Vapour Pressure | 1.35E-06mmHg at 25°C |
| Index of Refraction | 1.622 |
| InChIKey | JTXAGHXRIBLWES-UHFFFAOYSA-N |
| SMILES | Cc1cc(=O)oc2cc(O)c(Cl)cc12 |
| HS Code | 2932209090 |
|---|
| HS Code | 2932209090 |
|---|---|
| Summary | 2932209090. other lactones. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-Methyl-6-chlor-7-hydroxy-cumarin |
| 6-Chloro-7-hydroxy-4-methyl-2H-chromen-2-one |
| 6-Chlor-7-hydroxy-4-methyl-cumarin |
| 6-chloro-4-methylumbelliferone |
| 6-chloro-7-hydroxy-4-methyl-coumarin |
| XZZ |
| 6-chloro-7-hydroxy-4-methyl-2H-1-benzopyran-2-one |
| 6-chloro-7-hydroxy-4-methyl-chromen-2-one |