CID 118989813
Modify Date: 2026-08-19 18:24:47
CID 118989813 structure
|
Common Name | CID 118989813 | ||
|---|---|---|---|---|
| CAS Number | 1951441-97-6 | Molecular Weight | 462.8 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H50N2O4Si2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | CID 118989813 |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C22H50N2O4Si2 |
|---|---|
| Molecular Weight | 462.8 |
| InChIKey | KXPNWJJZCGUNSX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(CCN)C(CO[Si](C)(C)C(C)(C)C)CO[Si](C)(C)C(C)(C)C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of CID 118989813? |
| A: The English name of CID 118989813 is CID 118989813. |
| Q: What is the molecular formula of CID 118989813? |
| A: Molecular formula of CID 118989813 is C22H50N2O4Si2. |
| Q: What is the SMILES notation of CID 118989813? |
| A: SMILES notation of CID 118989813 is CC(C)(C)OC(=O)N(CCN)C(CO[Si](C)(C)C(C)(C)C)CO[Si](C)(C)C(C)(C)C. |
| Q: What is the molecular weight of CID 118989813? |
| A: Molecular weight of CID 118989813 is 462.8. |
| Q: What is the InChIKey of CID 118989813? |
| A: InChIKey of CID 118989813 is KXPNWJJZCGUNSX-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1951441-97-6? |
| A: Chinese name of 1951441-97-6 is 1951441-97-6. |
| Q: What is the CAS number of CID 118989813? |
| A: CAS number of CID 118989813 is 1951441-97-6. |