N-cyclopropyl-9-(cyclopropylmethyl)purin-6-amine structure
|
Common Name | N-cyclopropyl-9-(cyclopropylmethyl)purin-6-amine | ||
|---|---|---|---|---|
| CAS Number | 195252-21-2 | Molecular Weight | 229.28100 | |
| Density | 1.62g/cm3 | Boiling Point | 451.2ºC at 760 mmHg | |
| Molecular Formula | C12H15N5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 226.7ºC | |
| Name | N-cyclopropyl-9-(cyclopropylmethyl)purin-6-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.62g/cm3 |
|---|---|
| Boiling Point | 451.2ºC at 760 mmHg |
| Molecular Formula | C12H15N5 |
| Molecular Weight | 229.28100 |
| Flash Point | 226.7ºC |
| Exact Mass | 229.13300 |
| PSA | 55.63000 |
| LogP | 1.88360 |
| Vapour Pressure | 2.47E-08mmHg at 25°C |
| Index of Refraction | 1.862 |
| InChIKey | JEWJPJXPOUFBMO-UHFFFAOYSA-N |
| SMILES | c1nc(NC2CC2)c2ncn(CC3CC3)c2n1 |
|
~68%
N-cyclopropyl-9... CAS#:195252-21-2 |
| Literature: Kelley, James L.; Morris Bullock; Krochmal, Mark P.; McLean, Ed W.; Linn, James A.; Durcan, Micheal J.; Cooper, Barrett R. Journal of Medicinal Chemistry, 1997 , vol. 40, # 20 p. 3207 - 3216 |
| 9-(Cyclopropylmethyl)-6-(cyclopropylamino)-9H-purine |
| N-Cyclopropyl-9-(cyclopropylmethyl)-9H-purin-6-amine |
| 9H-Purin-6-amine,N-cyclopropyl-9-(cyclopropylmethyl) |