3,6-bis(acetylsulfanyl)-1,4-dimethyl-piperazine-2,5-dione structure
|
Common Name | 3,6-bis(acetylsulfanyl)-1,4-dimethyl-piperazine-2,5-dione | ||
|---|---|---|---|---|
| CAS Number | 19552-97-7 | Molecular Weight | 290.35900 | |
| Density | 1.41g/cm3 | Boiling Point | 524.9ºC at 760 mmHg | |
| Molecular Formula | C10H14N2O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 271.2ºC | |
| Name | S-(5-acetylsulfanyl-1,4-dimethyl-3,6-dioxopiperazin-2-yl) ethanethioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.41g/cm3 |
|---|---|
| Boiling Point | 524.9ºC at 760 mmHg |
| Molecular Formula | C10H14N2O4S2 |
| Molecular Weight | 290.35900 |
| Flash Point | 271.2ºC |
| Exact Mass | 290.03900 |
| PSA | 125.36000 |
| LogP | 0.00420 |
| Vapour Pressure | 4.14E-11mmHg at 25°C |
| Index of Refraction | 1.6 |
| InChIKey | ZHCFJFXVWQEUHL-UHFFFAOYSA-N |
| SMILES | CC(=O)SC1C(=O)N(C)C(SC(C)=O)C(=O)N1C |
|
~%
3,6-bis(acetyls... CAS#:19552-97-7 |
| Literature: UNIVERSITY OF SOUTHERN CALIFORNIA; OLENYUK, Bogdan, Z.; DUBEY, Ramin; LEVIN, Michael, D. Patent: WO2014/35484 A1, 2014 ; Location in patent: Paragraph 0120 ; |
|
~%
3,6-bis(acetyls... CAS#:19552-97-7 |
| Literature: UNIVERSITY OF SOUTHERN CALIFORNIA; OLENYUK, Bogdan, Z.; DUBEY, Ramin; LEVIN, Michael, D. Patent: WO2014/35484 A1, 2014 ; |
| 1,4-dimethyl-2,5-piperazinedione-3,6-dithioacetate |
| 3,6-bis-acetylsulfanyl-1,4-dimethyl-piperazine-2,5-dione |