(3S,4S)-1-Benzyl-4-(difluoromethyl)pyrrolidine-3-carboxylic acid hydrochloride
Modify Date: 2026-07-08 18:15:02
(3S,4S)-1-Benzyl-4-(difluoromethyl)pyrrolidine-3-carboxylic acid hydrochloride structure
|
Common Name | (3S,4S)-1-Benzyl-4-(difluoromethyl)pyrrolidine-3-carboxylic acid hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 1955473-75-2 | Molecular Weight | 291.72 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H16ClF2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (3S,4S)-1-Benzyl-4-(difluoromethyl)pyrrolidine-3-carboxylic acid hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H16ClF2NO2 |
|---|---|
| Molecular Weight | 291.72 |
| InChIKey | NQIVOQXKYWVGOS-NDXYWBNTSA-N |
| SMILES | Cl.O=C(O)C1CN(Cc2ccccc2)CC1C(F)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of (3S,4S)-1-Benzyl-4-(difluoromethyl)pyrrolidine-3-carboxylic acid hydrochloride? |
| A: InChIKey of (3S,4S)-1-Benzyl-4-(difluoromethyl)pyrrolidine-3-carboxylic acid hydrochloride is NQIVOQXKYWVGOS-NDXYWBNTSA-N. |
| Q: What is the CAS number of (3S,4S)-1-Benzyl-4-(difluoromethyl)pyrrolidine-3-carboxylic acid hydrochloride? |
| A: CAS number of (3S,4S)-1-Benzyl-4-(difluoromethyl)pyrrolidine-3-carboxylic acid hydrochloride is 1955473-75-2. |
| Q: What is the SMILES notation of (3S,4S)-1-Benzyl-4-(difluoromethyl)pyrrolidine-3-carboxylic acid hydrochloride? |
| A: SMILES notation of (3S,4S)-1-Benzyl-4-(difluoromethyl)pyrrolidine-3-carboxylic acid hydrochloride is Cl.O=C(O)C1CN(Cc2ccccc2)CC1C(F)F. |
| Q: What is the molecular formula of (3S,4S)-1-Benzyl-4-(difluoromethyl)pyrrolidine-3-carboxylic acid hydrochloride? |
| A: Molecular formula of (3S,4S)-1-Benzyl-4-(difluoromethyl)pyrrolidine-3-carboxylic acid hydrochloride is C13H16ClF2NO2. |
| Q: What is the Chinese name of 1955473-75-2? |
| A: Chinese name of 1955473-75-2 is 1955473-75-2. |
| Q: What is the English name of (3S,4S)-1-Benzyl-4-(difluoromethyl)pyrrolidine-3-carboxylic acid hydrochloride? |
| A: The English name of (3S,4S)-1-Benzyl-4-(difluoromethyl)pyrrolidine-3-carboxylic acid hydrochloride is (3S,4S)-1-Benzyl-4-(difluoromethyl)pyrrolidine-3-carboxylic acid hydrochloride. |
| Q: What is the molecular weight of (3S,4S)-1-Benzyl-4-(difluoromethyl)pyrrolidine-3-carboxylic acid hydrochloride? |
| A: Molecular weight of (3S,4S)-1-Benzyl-4-(difluoromethyl)pyrrolidine-3-carboxylic acid hydrochloride is 291.72. |