2-[1-(Propan-2-yl)-1H-pyrazol-5-yl]oxolane-3-carboxylic acid hydrochloride
Modify Date: 2026-09-05 19:09:08
![2-[1-(Propan-2-yl)-1H-pyrazol-5-yl]oxolane-3-carboxylic acid hydrochloride Structure](https://www.chemsrc.com/extcaspic/301/1955498-44-8.png)
2-[1-(Propan-2-yl)-1H-pyrazol-5-yl]oxolane-3-carboxylic acid hydrochloride structure
|
Common Name | 2-[1-(Propan-2-yl)-1H-pyrazol-5-yl]oxolane-3-carboxylic acid hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 1955498-44-8 | Molecular Weight | 260.72 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H17ClN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-[1-(Propan-2-yl)-1H-pyrazol-5-yl]oxolane-3-carboxylic acid hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H17ClN2O3 |
|---|---|
| Molecular Weight | 260.72 |
| InChIKey | XVCJXCVVVUNBAV-UHFFFAOYSA-N |
| SMILES | CC(C)n1nccc1C1OCCC1C(=O)O.Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 2-[1-(Propan-2-yl)-1H-pyrazol-5-yl]oxolane-3-carboxylic acid hydrochloride? |
| A: Molecular weight of 2-[1-(Propan-2-yl)-1H-pyrazol-5-yl]oxolane-3-carboxylic acid hydrochloride is 260.72. |
| Q: What is the molecular formula of 2-[1-(Propan-2-yl)-1H-pyrazol-5-yl]oxolane-3-carboxylic acid hydrochloride? |
| A: Molecular formula of 2-[1-(Propan-2-yl)-1H-pyrazol-5-yl]oxolane-3-carboxylic acid hydrochloride is C11H17ClN2O3. |
| Q: What is the CAS number of 2-[1-(Propan-2-yl)-1H-pyrazol-5-yl]oxolane-3-carboxylic acid hydrochloride? |
| A: CAS number of 2-[1-(Propan-2-yl)-1H-pyrazol-5-yl]oxolane-3-carboxylic acid hydrochloride is 1955498-44-8. |
| Q: What is the SMILES notation of 2-[1-(Propan-2-yl)-1H-pyrazol-5-yl]oxolane-3-carboxylic acid hydrochloride? |
| A: SMILES notation of 2-[1-(Propan-2-yl)-1H-pyrazol-5-yl]oxolane-3-carboxylic acid hydrochloride is CC(C)n1nccc1C1OCCC1C(=O)O.Cl. |
| Q: What is the Chinese name of 1955498-44-8? |
| A: Chinese name of 1955498-44-8 is 1955498-44-8. |
| Q: What is the English name of 2-[1-(Propan-2-yl)-1H-pyrazol-5-yl]oxolane-3-carboxylic acid hydrochloride? |
| A: The English name of 2-[1-(Propan-2-yl)-1H-pyrazol-5-yl]oxolane-3-carboxylic acid hydrochloride is 2-[1-(Propan-2-yl)-1H-pyrazol-5-yl]oxolane-3-carboxylic acid hydrochloride. |
| Q: What is the InChIKey of 2-[1-(Propan-2-yl)-1H-pyrazol-5-yl]oxolane-3-carboxylic acid hydrochloride? |
| A: InChIKey of 2-[1-(Propan-2-yl)-1H-pyrazol-5-yl]oxolane-3-carboxylic acid hydrochloride is XVCJXCVVVUNBAV-UHFFFAOYSA-N. |