3-(propan-2-yl)-2,3-dihydro-1H-inden-1-amine hydrochloride
Modify Date: 2026-08-19 09:19:30
3-(propan-2-yl)-2,3-dihydro-1H-inden-1-amine hydrochloride structure
|
Common Name | 3-(propan-2-yl)-2,3-dihydro-1H-inden-1-amine hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 1955506-88-3 | Molecular Weight | 211.73 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H18ClN | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(propan-2-yl)-2,3-dihydro-1H-inden-1-amine hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H18ClN |
|---|---|
| Molecular Weight | 211.73 |
| InChIKey | MIIBGAYAGRTKRM-UHFFFAOYSA-N |
| SMILES | CC(C)C1CC(N)c2ccccc21.Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 3-(propan-2-yl)-2,3-dihydro-1H-inden-1-amine hydrochloride? |
| A: Molecular weight of 3-(propan-2-yl)-2,3-dihydro-1H-inden-1-amine hydrochloride is 211.73. |
| Q: What is the English name of 3-(propan-2-yl)-2,3-dihydro-1H-inden-1-amine hydrochloride? |
| A: The English name of 3-(propan-2-yl)-2,3-dihydro-1H-inden-1-amine hydrochloride is 3-(propan-2-yl)-2,3-dihydro-1H-inden-1-amine hydrochloride. |
| Q: What is the InChIKey of 3-(propan-2-yl)-2,3-dihydro-1H-inden-1-amine hydrochloride? |
| A: InChIKey of 3-(propan-2-yl)-2,3-dihydro-1H-inden-1-amine hydrochloride is MIIBGAYAGRTKRM-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1955506-88-3? |
| A: Chinese name of 1955506-88-3 is 1955506-88-3. |
| Q: What is the CAS number of 3-(propan-2-yl)-2,3-dihydro-1H-inden-1-amine hydrochloride? |
| A: CAS number of 3-(propan-2-yl)-2,3-dihydro-1H-inden-1-amine hydrochloride is 1955506-88-3. |
| Q: What is the SMILES notation of 3-(propan-2-yl)-2,3-dihydro-1H-inden-1-amine hydrochloride? |
| A: SMILES notation of 3-(propan-2-yl)-2,3-dihydro-1H-inden-1-amine hydrochloride is CC(C)C1CC(N)c2ccccc21.Cl. |
| Q: What is the molecular formula of 3-(propan-2-yl)-2,3-dihydro-1H-inden-1-amine hydrochloride? |
| A: Molecular formula of 3-(propan-2-yl)-2,3-dihydro-1H-inden-1-amine hydrochloride is C12H18ClN. |