2-(Azepan-4-yl)acetamide,bis(trifluoroaceticacid)
Modify Date: 2025-09-10 10:18:26
2-(Azepan-4-yl)acetamide,bis(trifluoroaceticacid) structure
|
Common Name | 2-(Azepan-4-yl)acetamide,bis(trifluoroaceticacid) | ||
|---|---|---|---|---|
| CAS Number | 1955523-36-0 | Molecular Weight | 384.27 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H18F6N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(Azepan-4-yl)acetamide,bis(trifluoroaceticacid) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H18F6N2O5 |
|---|---|
| Molecular Weight | 384.27 |
| InChIKey | LMEHXJHGPDXCNF-UHFFFAOYSA-N |
| SMILES | NC(=O)CC1CCCNCC1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2-(Azepan-4-yl)acetamide,bis(trifluoroaceticacid)? |
| A: CAS number of 2-(Azepan-4-yl)acetamide,bis(trifluoroaceticacid) is 1955523-36-0. |
| Q: What is the SMILES notation of 2-(Azepan-4-yl)acetamide,bis(trifluoroaceticacid)? |
| A: SMILES notation of 2-(Azepan-4-yl)acetamide,bis(trifluoroaceticacid) is NC(=O)CC1CCCNCC1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F. |
| Q: What is the Chinese name of 1955523-36-0? |
| A: Chinese name of 1955523-36-0 is 1955523-36-0. |
| Q: What is the English name of 2-(Azepan-4-yl)acetamide,bis(trifluoroaceticacid)? |
| A: The English name of 2-(Azepan-4-yl)acetamide,bis(trifluoroaceticacid) is 2-(Azepan-4-yl)acetamide,bis(trifluoroaceticacid). |
| Q: What is the molecular formula of 2-(Azepan-4-yl)acetamide,bis(trifluoroaceticacid)? |
| A: Molecular formula of 2-(Azepan-4-yl)acetamide,bis(trifluoroaceticacid) is C12H18F6N2O5. |
| Q: What is the InChIKey of 2-(Azepan-4-yl)acetamide,bis(trifluoroaceticacid)? |
| A: InChIKey of 2-(Azepan-4-yl)acetamide,bis(trifluoroaceticacid) is LMEHXJHGPDXCNF-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 2-(Azepan-4-yl)acetamide,bis(trifluoroaceticacid)? |
| A: Molecular weight of 2-(Azepan-4-yl)acetamide,bis(trifluoroaceticacid) is 384.27. |