3-(Morpholin-4-yl)propane-1-sulfonyl fluoride hydrochloride
Modify Date: 2026-07-02 09:06:56
3-(Morpholin-4-yl)propane-1-sulfonyl fluoride hydrochloride structure
|
Common Name | 3-(Morpholin-4-yl)propane-1-sulfonyl fluoride hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 1955558-36-7 | Molecular Weight | 247.72 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H15ClFNO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(Morpholin-4-yl)propane-1-sulfonyl fluoride hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7H15ClFNO3S |
|---|---|
| Molecular Weight | 247.72 |
| InChIKey | SWGNJPMCZZAHMN-UHFFFAOYSA-N |
| SMILES | Cl.O=S(=O)(F)CCCN1CCOCC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 3-(Morpholin-4-yl)propane-1-sulfonyl fluoride hydrochloride? |
| A: Molecular formula of 3-(Morpholin-4-yl)propane-1-sulfonyl fluoride hydrochloride is C7H15ClFNO3S. |
| Q: What is the SMILES notation of 3-(Morpholin-4-yl)propane-1-sulfonyl fluoride hydrochloride? |
| A: SMILES notation of 3-(Morpholin-4-yl)propane-1-sulfonyl fluoride hydrochloride is Cl.O=S(=O)(F)CCCN1CCOCC1. |
| Q: What is the molecular weight of 3-(Morpholin-4-yl)propane-1-sulfonyl fluoride hydrochloride? |
| A: Molecular weight of 3-(Morpholin-4-yl)propane-1-sulfonyl fluoride hydrochloride is 247.72. |
| Q: What is the InChIKey of 3-(Morpholin-4-yl)propane-1-sulfonyl fluoride hydrochloride? |
| A: InChIKey of 3-(Morpholin-4-yl)propane-1-sulfonyl fluoride hydrochloride is SWGNJPMCZZAHMN-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1955558-36-7? |
| A: Chinese name of 1955558-36-7 is 1955558-36-7. |
| Q: What is the CAS number of 3-(Morpholin-4-yl)propane-1-sulfonyl fluoride hydrochloride? |
| A: CAS number of 3-(Morpholin-4-yl)propane-1-sulfonyl fluoride hydrochloride is 1955558-36-7. |
| Q: What is the English name of 3-(Morpholin-4-yl)propane-1-sulfonyl fluoride hydrochloride? |
| A: The English name of 3-(Morpholin-4-yl)propane-1-sulfonyl fluoride hydrochloride is 3-(Morpholin-4-yl)propane-1-sulfonyl fluoride hydrochloride. |