6-(Difluoromethoxy)-3,4-dihydronaphthalene-2-sulfonyl fluoride
Modify Date: 2026-07-16 09:02:43
6-(Difluoromethoxy)-3,4-dihydronaphthalene-2-sulfonyl fluoride structure
|
Common Name | 6-(Difluoromethoxy)-3,4-dihydronaphthalene-2-sulfonyl fluoride | ||
|---|---|---|---|---|
| CAS Number | 1955561-15-5 | Molecular Weight | 278.25 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H9F3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-(Difluoromethoxy)-3,4-dihydronaphthalene-2-sulfonyl fluoride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H9F3O3S |
|---|---|
| Molecular Weight | 278.25 |
| InChIKey | FQNSQYORLMNXDM-UHFFFAOYSA-N |
| SMILES | O=S(=O)(F)C1=Cc2ccc(OC(F)F)cc2CC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1955561-15-5? |
| A: Chinese name of 1955561-15-5 is 1955561-15-5. |
| Q: What is the CAS number of 6-(Difluoromethoxy)-3,4-dihydronaphthalene-2-sulfonyl fluoride? |
| A: CAS number of 6-(Difluoromethoxy)-3,4-dihydronaphthalene-2-sulfonyl fluoride is 1955561-15-5. |
| Q: What is the molecular weight of 6-(Difluoromethoxy)-3,4-dihydronaphthalene-2-sulfonyl fluoride? |
| A: Molecular weight of 6-(Difluoromethoxy)-3,4-dihydronaphthalene-2-sulfonyl fluoride is 278.25. |
| Q: What is the English name of 6-(Difluoromethoxy)-3,4-dihydronaphthalene-2-sulfonyl fluoride? |
| A: The English name of 6-(Difluoromethoxy)-3,4-dihydronaphthalene-2-sulfonyl fluoride is 6-(Difluoromethoxy)-3,4-dihydronaphthalene-2-sulfonyl fluoride. |
| Q: What is the InChIKey of 6-(Difluoromethoxy)-3,4-dihydronaphthalene-2-sulfonyl fluoride? |
| A: InChIKey of 6-(Difluoromethoxy)-3,4-dihydronaphthalene-2-sulfonyl fluoride is FQNSQYORLMNXDM-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 6-(Difluoromethoxy)-3,4-dihydronaphthalene-2-sulfonyl fluoride? |
| A: SMILES notation of 6-(Difluoromethoxy)-3,4-dihydronaphthalene-2-sulfonyl fluoride is O=S(=O)(F)C1=Cc2ccc(OC(F)F)cc2CC1. |
| Q: What is the molecular formula of 6-(Difluoromethoxy)-3,4-dihydronaphthalene-2-sulfonyl fluoride? |
| A: Molecular formula of 6-(Difluoromethoxy)-3,4-dihydronaphthalene-2-sulfonyl fluoride is C11H9F3O3S. |