tert-Butyl 4-(fluoromethyl)-5-oxo-4,5-dihydropyrazine-2-carboxylate
Modify Date: 2026-08-15 20:05:37
tert-Butyl 4-(fluoromethyl)-5-oxo-4,5-dihydropyrazine-2-carboxylate structure
|
Common Name | tert-Butyl 4-(fluoromethyl)-5-oxo-4,5-dihydropyrazine-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 1956306-79-8 | Molecular Weight | 228.22 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H13FN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | tert-Butyl 4-(fluoromethyl)-5-oxo-4,5-dihydropyrazine-2-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H13FN2O3 |
|---|---|
| Molecular Weight | 228.22 |
| InChIKey | GPOMTFFTXSMAFV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)c1cn(CF)c(=O)cn1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of tert-Butyl 4-(fluoromethyl)-5-oxo-4,5-dihydropyrazine-2-carboxylate? |
| A: The English name of tert-Butyl 4-(fluoromethyl)-5-oxo-4,5-dihydropyrazine-2-carboxylate is tert-Butyl 4-(fluoromethyl)-5-oxo-4,5-dihydropyrazine-2-carboxylate. |
| Q: What is the molecular formula of tert-Butyl 4-(fluoromethyl)-5-oxo-4,5-dihydropyrazine-2-carboxylate? |
| A: Molecular formula of tert-Butyl 4-(fluoromethyl)-5-oxo-4,5-dihydropyrazine-2-carboxylate is C10H13FN2O3. |
| Q: What is the molecular weight of tert-Butyl 4-(fluoromethyl)-5-oxo-4,5-dihydropyrazine-2-carboxylate? |
| A: Molecular weight of tert-Butyl 4-(fluoromethyl)-5-oxo-4,5-dihydropyrazine-2-carboxylate is 228.22. |
| Q: What is the CAS number of tert-Butyl 4-(fluoromethyl)-5-oxo-4,5-dihydropyrazine-2-carboxylate? |
| A: CAS number of tert-Butyl 4-(fluoromethyl)-5-oxo-4,5-dihydropyrazine-2-carboxylate is 1956306-79-8. |
| Q: What is the Chinese name of 1956306-79-8? |
| A: Chinese name of 1956306-79-8 is 1956306-79-8. |
| Q: What is the SMILES notation of tert-Butyl 4-(fluoromethyl)-5-oxo-4,5-dihydropyrazine-2-carboxylate? |
| A: SMILES notation of tert-Butyl 4-(fluoromethyl)-5-oxo-4,5-dihydropyrazine-2-carboxylate is CC(C)(C)OC(=O)c1cn(CF)c(=O)cn1. |
| Q: What is the InChIKey of tert-Butyl 4-(fluoromethyl)-5-oxo-4,5-dihydropyrazine-2-carboxylate? |
| A: InChIKey of tert-Butyl 4-(fluoromethyl)-5-oxo-4,5-dihydropyrazine-2-carboxylate is GPOMTFFTXSMAFV-UHFFFAOYSA-N. |