5-(3-Fluorophenyl)-[1,2,4]triazolo[1,5-a]pyrazin-2-amine
Modify Date: 2026-08-05 14:17:17
![5-(3-Fluorophenyl)-[1,2,4]triazolo[1,5-a]pyrazin-2-amine Structure](https://www.chemsrc.com/extcaspic/041/1956322-63-6.png)
5-(3-Fluorophenyl)-[1,2,4]triazolo[1,5-a]pyrazin-2-amine structure
|
Common Name | 5-(3-Fluorophenyl)-[1,2,4]triazolo[1,5-a]pyrazin-2-amine | ||
|---|---|---|---|---|
| CAS Number | 1956322-63-6 | Molecular Weight | 229.21 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H8FN5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-(3-Fluorophenyl)-[1,2,4]triazolo[1,5-a]pyrazin-2-amine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H8FN5 |
|---|---|
| Molecular Weight | 229.21 |
| InChIKey | OCJJCWTUCKXECP-UHFFFAOYSA-N |
| SMILES | Nc1nc2cncc(-c3cccc(F)c3)n2n1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 5-(3-Fluorophenyl)-[1,2,4]triazolo[1,5-a]pyrazin-2-amine? |
| A: InChIKey of 5-(3-Fluorophenyl)-[1,2,4]triazolo[1,5-a]pyrazin-2-amine is OCJJCWTUCKXECP-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 5-(3-Fluorophenyl)-[1,2,4]triazolo[1,5-a]pyrazin-2-amine? |
| A: Molecular formula of 5-(3-Fluorophenyl)-[1,2,4]triazolo[1,5-a]pyrazin-2-amine is C11H8FN5. |
| Q: What is the CAS number of 5-(3-Fluorophenyl)-[1,2,4]triazolo[1,5-a]pyrazin-2-amine? |
| A: CAS number of 5-(3-Fluorophenyl)-[1,2,4]triazolo[1,5-a]pyrazin-2-amine is 1956322-63-6. |
| Q: What is the SMILES notation of 5-(3-Fluorophenyl)-[1,2,4]triazolo[1,5-a]pyrazin-2-amine? |
| A: SMILES notation of 5-(3-Fluorophenyl)-[1,2,4]triazolo[1,5-a]pyrazin-2-amine is Nc1nc2cncc(-c3cccc(F)c3)n2n1. |
| Q: What is the Chinese name of 1956322-63-6? |
| A: Chinese name of 1956322-63-6 is 1956322-63-6. |
| Q: What is the molecular weight of 5-(3-Fluorophenyl)-[1,2,4]triazolo[1,5-a]pyrazin-2-amine? |
| A: Molecular weight of 5-(3-Fluorophenyl)-[1,2,4]triazolo[1,5-a]pyrazin-2-amine is 229.21. |
| Q: What is the English name of 5-(3-Fluorophenyl)-[1,2,4]triazolo[1,5-a]pyrazin-2-amine? |
| A: The English name of 5-(3-Fluorophenyl)-[1,2,4]triazolo[1,5-a]pyrazin-2-amine is 5-(3-Fluorophenyl)-[1,2,4]triazolo[1,5-a]pyrazin-2-amine. |