8-(Bromomethyl)-2,2,6-trimethyl-4H-benzo[d][1,3]dioxin-4-one structure
|
Common Name | 8-(Bromomethyl)-2,2,6-trimethyl-4H-benzo[d][1,3]dioxin-4-one | ||
|---|---|---|---|---|
| CAS Number | 1956322-90-9 | Molecular Weight | 285.13 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H13BrO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 8-(Bromomethyl)-2,2,6-trimethyl-4H-benzo[d][1,3]dioxin-4-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H13BrO3 |
|---|---|
| Molecular Weight | 285.13 |
| InChIKey | MEYCVULWQVARCN-UHFFFAOYSA-N |
| SMILES | Cc1cc(CBr)c2c(c1)C(=O)OC(C)(C)O2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 8-(Bromomethyl)-2,2,6-trimethyl-4H-benzo[d][1,3]dioxin-4-one? |
| A: CAS number of 8-(Bromomethyl)-2,2,6-trimethyl-4H-benzo[d][1,3]dioxin-4-one is 1956322-90-9. |
| Q: What is the SMILES notation of 8-(Bromomethyl)-2,2,6-trimethyl-4H-benzo[d][1,3]dioxin-4-one? |
| A: SMILES notation of 8-(Bromomethyl)-2,2,6-trimethyl-4H-benzo[d][1,3]dioxin-4-one is Cc1cc(CBr)c2c(c1)C(=O)OC(C)(C)O2. |
| Q: What is the Chinese name of 1956322-90-9? |
| A: Chinese name of 1956322-90-9 is 1956322-90-9. |
| Q: What is the InChIKey of 8-(Bromomethyl)-2,2,6-trimethyl-4H-benzo[d][1,3]dioxin-4-one? |
| A: InChIKey of 8-(Bromomethyl)-2,2,6-trimethyl-4H-benzo[d][1,3]dioxin-4-one is MEYCVULWQVARCN-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 8-(Bromomethyl)-2,2,6-trimethyl-4H-benzo[d][1,3]dioxin-4-one? |
| A: Molecular weight of 8-(Bromomethyl)-2,2,6-trimethyl-4H-benzo[d][1,3]dioxin-4-one is 285.13. |
| Q: What is the English name of 8-(Bromomethyl)-2,2,6-trimethyl-4H-benzo[d][1,3]dioxin-4-one? |
| A: The English name of 8-(Bromomethyl)-2,2,6-trimethyl-4H-benzo[d][1,3]dioxin-4-one is 8-(Bromomethyl)-2,2,6-trimethyl-4H-benzo[d][1,3]dioxin-4-one. |
| Q: What is the molecular formula of 8-(Bromomethyl)-2,2,6-trimethyl-4H-benzo[d][1,3]dioxin-4-one? |
| A: Molecular formula of 8-(Bromomethyl)-2,2,6-trimethyl-4H-benzo[d][1,3]dioxin-4-one is C12H13BrO3. |