Isopropyl 3-(1-trityl-1H-imidazol-4-yl)propanoate
Modify Date: 2026-09-24 17:15:10
Isopropyl 3-(1-trityl-1H-imidazol-4-yl)propanoate structure
|
Common Name | Isopropyl 3-(1-trityl-1H-imidazol-4-yl)propanoate | ||
|---|---|---|---|---|
| CAS Number | 1956324-88-1 | Molecular Weight | 424.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H28N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Isopropyl 3-(1-trityl-1H-imidazol-4-yl)propanoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C28H28N2O2 |
|---|---|
| Molecular Weight | 424.5 |
| InChIKey | JDCBLZFKPREEKZ-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)CCc1cn(C(c2ccccc2)(c2ccccc2)c2ccccc2)cn1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of Isopropyl 3-(1-trityl-1H-imidazol-4-yl)propanoate? |
| A: SMILES notation of Isopropyl 3-(1-trityl-1H-imidazol-4-yl)propanoate is CC(C)OC(=O)CCc1cn(C(c2ccccc2)(c2ccccc2)c2ccccc2)cn1. |
| Q: What is the CAS number of Isopropyl 3-(1-trityl-1H-imidazol-4-yl)propanoate? |
| A: CAS number of Isopropyl 3-(1-trityl-1H-imidazol-4-yl)propanoate is 1956324-88-1. |
| Q: What is the molecular formula of Isopropyl 3-(1-trityl-1H-imidazol-4-yl)propanoate? |
| A: Molecular formula of Isopropyl 3-(1-trityl-1H-imidazol-4-yl)propanoate is C28H28N2O2. |
| Q: What is the molecular weight of Isopropyl 3-(1-trityl-1H-imidazol-4-yl)propanoate? |
| A: Molecular weight of Isopropyl 3-(1-trityl-1H-imidazol-4-yl)propanoate is 424.5. |
| Q: What is the Chinese name of 1956324-88-1? |
| A: Chinese name of 1956324-88-1 is 1956324-88-1. |
| Q: What is the English name of Isopropyl 3-(1-trityl-1H-imidazol-4-yl)propanoate? |
| A: The English name of Isopropyl 3-(1-trityl-1H-imidazol-4-yl)propanoate is Isopropyl 3-(1-trityl-1H-imidazol-4-yl)propanoate. |
| Q: What is the InChIKey of Isopropyl 3-(1-trityl-1H-imidazol-4-yl)propanoate? |
| A: InChIKey of Isopropyl 3-(1-trityl-1H-imidazol-4-yl)propanoate is JDCBLZFKPREEKZ-UHFFFAOYSA-N. |