Dicyclohexylamine 4,6-dihydrothieno[3,4-b]thiophene-2-carboxylate
Modify Date: 2026-08-30 11:50:44
![Dicyclohexylamine 4,6-dihydrothieno[3,4-b]thiophene-2-carboxylate Structure](https://www.chemsrc.com/extcaspic/340/1956341-34-6.png)
Dicyclohexylamine 4,6-dihydrothieno[3,4-b]thiophene-2-carboxylate structure
|
Common Name | Dicyclohexylamine 4,6-dihydrothieno[3,4-b]thiophene-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 1956341-34-6 | Molecular Weight | 367.6 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H29NO2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Dicyclohexylamine 4,6-dihydrothieno[3,4-b]thiophene-2-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C19H29NO2S2 |
|---|---|
| Molecular Weight | 367.6 |
| InChIKey | PKEUUYGTORAFGW-UHFFFAOYSA-N |
| SMILES | C1CCC(NC2CCCCC2)CC1.O=C(O)c1cc2c(s1)CSC2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1956341-34-6? |
| A: Chinese name of 1956341-34-6 is 1956341-34-6. |
| Q: What is the SMILES notation of Dicyclohexylamine 4,6-dihydrothieno[3,4-b]thiophene-2-carboxylate? |
| A: SMILES notation of Dicyclohexylamine 4,6-dihydrothieno[3,4-b]thiophene-2-carboxylate is C1CCC(NC2CCCCC2)CC1.O=C(O)c1cc2c(s1)CSC2. |
| Q: What is the CAS number of Dicyclohexylamine 4,6-dihydrothieno[3,4-b]thiophene-2-carboxylate? |
| A: CAS number of Dicyclohexylamine 4,6-dihydrothieno[3,4-b]thiophene-2-carboxylate is 1956341-34-6. |
| Q: What is the molecular weight of Dicyclohexylamine 4,6-dihydrothieno[3,4-b]thiophene-2-carboxylate? |
| A: Molecular weight of Dicyclohexylamine 4,6-dihydrothieno[3,4-b]thiophene-2-carboxylate is 367.6. |
| Q: What is the InChIKey of Dicyclohexylamine 4,6-dihydrothieno[3,4-b]thiophene-2-carboxylate? |
| A: InChIKey of Dicyclohexylamine 4,6-dihydrothieno[3,4-b]thiophene-2-carboxylate is PKEUUYGTORAFGW-UHFFFAOYSA-N. |
| Q: What is the English name of Dicyclohexylamine 4,6-dihydrothieno[3,4-b]thiophene-2-carboxylate? |
| A: The English name of Dicyclohexylamine 4,6-dihydrothieno[3,4-b]thiophene-2-carboxylate is Dicyclohexylamine 4,6-dihydrothieno[3,4-b]thiophene-2-carboxylate. |
| Q: What is the molecular formula of Dicyclohexylamine 4,6-dihydrothieno[3,4-b]thiophene-2-carboxylate? |
| A: Molecular formula of Dicyclohexylamine 4,6-dihydrothieno[3,4-b]thiophene-2-carboxylate is C19H29NO2S2. |